About 5-[(1R,5S)-3-fluoro-3-(methoxymethyl)-6-bicyclo[3.1.0]hexanyl]-3-iodo-1-propan-2-ylpyrazole
5-[(1R,5S)-3-fluoro-3-(methoxymethyl)-6-bicyclo[3.1.0]hexanyl]-3-iodo-1-propan-2-ylpyrazole (PubChem CID 118161753) has the molecular formula C14H20FIN2O
and a molecular weight of 378.23 g/mol. Its IUPAC name is 5-[(1R,5S)-3-fluoro-3-(methoxymethyl)-6-bicyclo[3.1.0]hexanyl]-3-iodo-1-propan-2-ylpyrazole.
Molecular Properties
| Compound Name | 5-[(1R,5S)-3-fluoro-3-(methoxymethyl)-6-bicyclo[3.1.0]hexanyl]-3-iodo-1-propan-2-ylpyrazole |
| PubChem CID | 118161753 |
| Molecular Formula | C14H20FIN2O |
| Molecular Weight | 378.23 g/mol |
| Exact Mass | 378.06 |
| IUPAC Name | 5-[(1R,5S)-3-fluoro-3-(methoxymethyl)-6-bicyclo[3.1.0]hexanyl]-3-iodo-1-propan-2-ylpyrazole |
| SMILES | COCC1(F)C[C@@H]2C(c3cc(I)nn3C(C)C)[C@@H]2C1 |
| InChI | InChI=1S/C14H20FIN2O/c1-8(2)18-11(4-12(16)17-18)13-9-5-14(15,7-19-3)6-10(9)13/h4,8-10,13H,5-7H2,1-3H3/t9-,10+,13?,14? |
| InChIKey | OKRLRKVVZSEDSE-XYAOECAESA-N |
| XLogP | 3.55 |
| TPSA | 27.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 378.23 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 5-[(1R,5S)-3-fluoro-3-(methoxymethyl)-6-bicyclo[3.1.0]hexanyl]-3-iodo-1-propan-2-ylpyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(1R,5S)-3-fluoro-3-(methoxymethyl)-6-bicyclo[3.1.0]hexanyl]-3-iodo-1-propan-2-ylpyrazole?
The IUPAC name of 5-[(1R,5S)-3-fluoro-3-(methoxymethyl)-6-bicyclo[3.1.0]hexanyl]-3-iodo-1-propan-2-ylpyrazole (CID 118161753) is 5-[(1R,5S)-3-fluoro-3-(methoxymethyl)-6-bicyclo[3.1.0]hexanyl]-3-iodo-1-propan-2-ylpyrazole.
What is the SMILES notation for 5-[(1R,5S)-3-fluoro-3-(methoxymethyl)-6-bicyclo[3.1.0]hexanyl]-3-iodo-1-propan-2-ylpyrazole?
The canonical SMILES for 5-[(1R,5S)-3-fluoro-3-(methoxymethyl)-6-bicyclo[3.1.0]hexanyl]-3-iodo-1-propan-2-ylpyrazole is COCC1(F)C[C@@H]2C(c3cc(I)nn3C(C)C)[C@@H]2C1.
What is the InChIKey of 5-[(1R,5S)-3-fluoro-3-(methoxymethyl)-6-bicyclo[3.1.0]hexanyl]-3-iodo-1-propan-2-ylpyrazole?
The InChIKey is OKRLRKVVZSEDSE-XYAOECAESA-N. The full InChI is InChI=1S/C14H20FIN2O/c1-8(2)18-11(4-12(16)17-18)13-9-5-14(15,7-19-3)6-10(9)13/h4,8-10,13H,5-7H2,1-3H3/t9-,10+,13?,14?.
What are the key properties of 5-[(1R,5S)-3-fluoro-3-(methoxymethyl)-6-bicyclo[3.1.0]hexanyl]-3-iodo-1-propan-2-ylpyrazole?
5-[(1R,5S)-3-fluoro-3-(methoxymethyl)-6-bicyclo[3.1.0]hexanyl]-3-iodo-1-propan-2-ylpyrazole has a molecular weight of 378.23 g/mol, XLogP of 3.55, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(1R,5S)-3-fluoro-3-(methoxymethyl)-6-bicyclo[3.1.0]hexanyl]-3-iodo-1-propan-2-ylpyrazole is sourced from PubChem (CID 118161753), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).