About [(1R,5S)-3-fluoro-6-(3-iodo-1-propan-2-ylpyrazol-5-yl)-3-bicyclo[3.1.0]hexanyl]methanol
[(1R,5S)-3-fluoro-6-(3-iodo-1-propan-2-ylpyrazol-5-yl)-3-bicyclo[3.1.0]hexanyl]methanol (PubChem CID 118161812) has the molecular formula C13H18FIN2O
and a molecular weight of 364.20 g/mol. Its IUPAC name is [(1R,5S)-3-fluoro-6-(3-iodo-1-propan-2-ylpyrazol-5-yl)-3-bicyclo[3.1.0]hexanyl]methanol.
Molecular Properties
| Compound Name | [(1R,5S)-3-fluoro-6-(3-iodo-1-propan-2-ylpyrazol-5-yl)-3-bicyclo[3.1.0]hexanyl]methanol |
| PubChem CID | 118161812 |
| Molecular Formula | C13H18FIN2O |
| Molecular Weight | 364.20 g/mol |
| Exact Mass | 364.04 |
| IUPAC Name | [(1R,5S)-3-fluoro-6-(3-iodo-1-propan-2-ylpyrazol-5-yl)-3-bicyclo[3.1.0]hexanyl]methanol |
| SMILES | CC(C)n1nc(I)cc1C1[C@H]2CC(F)(CO)C[C@@H]12 |
| InChI | InChI=1S/C13H18FIN2O/c1-7(2)17-10(3-11(15)16-17)12-8-4-13(14,6-18)5-9(8)12/h3,7-9,12,18H,4-6H2,1-2H3/t8-,9+,12?,13? |
| InChIKey | JYWIUBKIAMSFIT-RFZWMSCOSA-N |
| XLogP | 2.89 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 364.20 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze [(1R,5S)-3-fluoro-6-(3-iodo-1-propan-2-ylpyrazol-5-yl)-3-bicyclo[3.1.0]hexanyl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1R,5S)-3-fluoro-6-(3-iodo-1-propan-2-ylpyrazol-5-yl)-3-bicyclo[3.1.0]hexanyl]methanol?
The IUPAC name of [(1R,5S)-3-fluoro-6-(3-iodo-1-propan-2-ylpyrazol-5-yl)-3-bicyclo[3.1.0]hexanyl]methanol (CID 118161812) is [(1R,5S)-3-fluoro-6-(3-iodo-1-propan-2-ylpyrazol-5-yl)-3-bicyclo[3.1.0]hexanyl]methanol.
What is the SMILES notation for [(1R,5S)-3-fluoro-6-(3-iodo-1-propan-2-ylpyrazol-5-yl)-3-bicyclo[3.1.0]hexanyl]methanol?
The canonical SMILES for [(1R,5S)-3-fluoro-6-(3-iodo-1-propan-2-ylpyrazol-5-yl)-3-bicyclo[3.1.0]hexanyl]methanol is CC(C)n1nc(I)cc1C1[C@H]2CC(F)(CO)C[C@@H]12.
What is the InChIKey of [(1R,5S)-3-fluoro-6-(3-iodo-1-propan-2-ylpyrazol-5-yl)-3-bicyclo[3.1.0]hexanyl]methanol?
The InChIKey is JYWIUBKIAMSFIT-RFZWMSCOSA-N. The full InChI is InChI=1S/C13H18FIN2O/c1-7(2)17-10(3-11(15)16-17)12-8-4-13(14,6-18)5-9(8)12/h3,7-9,12,18H,4-6H2,1-2H3/t8-,9+,12?,13?.
What are the key properties of [(1R,5S)-3-fluoro-6-(3-iodo-1-propan-2-ylpyrazol-5-yl)-3-bicyclo[3.1.0]hexanyl]methanol?
[(1R,5S)-3-fluoro-6-(3-iodo-1-propan-2-ylpyrazol-5-yl)-3-bicyclo[3.1.0]hexanyl]methanol has a molecular weight of 364.20 g/mol, XLogP of 2.89, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(1R,5S)-3-fluoro-6-(3-iodo-1-propan-2-ylpyrazol-5-yl)-3-bicyclo[3.1.0]hexanyl]methanol is sourced from PubChem (CID 118161812), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).