About 3-[(3-methylimidazol-4-yl)methoxy]-5-[4-(trifluoromethoxy)phenyl]-1,2-benzoxazole
3-[(3-methylimidazol-4-yl)methoxy]-5-[4-(trifluoromethoxy)phenyl]-1,2-benzoxazole (PubChem CID 118161878) has the molecular formula C19H14F3N3O3
and a molecular weight of 389.33 g/mol. Its IUPAC name is 3-[(3-methylimidazol-4-yl)methoxy]-5-[4-(trifluoromethoxy)phenyl]-1,2-benzoxazole.
Molecular Properties
| Compound Name | 3-[(3-methylimidazol-4-yl)methoxy]-5-[4-(trifluoromethoxy)phenyl]-1,2-benzoxazole |
| PubChem CID | 118161878 |
| Molecular Formula | C19H14F3N3O3 |
| Molecular Weight | 389.33 g/mol |
| Exact Mass | 389.10 |
| IUPAC Name | 3-[(3-methylimidazol-4-yl)methoxy]-5-[4-(trifluoromethoxy)phenyl]-1,2-benzoxazole |
| SMILES | Cn1cncc1COc1noc2ccc(-c3ccc(OC(F)(F)F)cc3)cc12 |
| InChI | InChI=1S/C19H14F3N3O3/c1-25-11-23-9-14(25)10-26-18-16-8-13(4-7-17(16)28-24-18)12-2-5-15(6-3-12)27-19(20,21)22/h2-9,11H,10H2,1H3 |
| InChIKey | LADCWUROFRTCSA-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 62.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 389.33 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 3-[(3-methylimidazol-4-yl)methoxy]-5-[4-(trifluoromethoxy)phenyl]-1,2-benzoxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(3-methylimidazol-4-yl)methoxy]-5-[4-(trifluoromethoxy)phenyl]-1,2-benzoxazole?
The IUPAC name of 3-[(3-methylimidazol-4-yl)methoxy]-5-[4-(trifluoromethoxy)phenyl]-1,2-benzoxazole (CID 118161878) is 3-[(3-methylimidazol-4-yl)methoxy]-5-[4-(trifluoromethoxy)phenyl]-1,2-benzoxazole.
What is the SMILES notation for 3-[(3-methylimidazol-4-yl)methoxy]-5-[4-(trifluoromethoxy)phenyl]-1,2-benzoxazole?
The canonical SMILES for 3-[(3-methylimidazol-4-yl)methoxy]-5-[4-(trifluoromethoxy)phenyl]-1,2-benzoxazole is Cn1cncc1COc1noc2ccc(-c3ccc(OC(F)(F)F)cc3)cc12.
What is the InChIKey of 3-[(3-methylimidazol-4-yl)methoxy]-5-[4-(trifluoromethoxy)phenyl]-1,2-benzoxazole?
The InChIKey is LADCWUROFRTCSA-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H14F3N3O3/c1-25-11-23-9-14(25)10-26-18-16-8-13(4-7-17(16)28-24-18)12-2-5-15(6-3-12)27-19(20,21)22/h2-9,11H,10H2,1H3.
What are the key properties of 3-[(3-methylimidazol-4-yl)methoxy]-5-[4-(trifluoromethoxy)phenyl]-1,2-benzoxazole?
3-[(3-methylimidazol-4-yl)methoxy]-5-[4-(trifluoromethoxy)phenyl]-1,2-benzoxazole has a molecular weight of 389.33 g/mol, XLogP of 4.71, 5 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(3-methylimidazol-4-yl)methoxy]-5-[4-(trifluoromethoxy)phenyl]-1,2-benzoxazole is sourced from PubChem (CID 118161878), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).