About (2R)-4-[1-[6-(diethoxymethyl)-3-fluoro-2-pyridinyl]azetidin-3-yl]-1,2-dimethylpiperazine
(2R)-4-[1-[6-(diethoxymethyl)-3-fluoro-2-pyridinyl]azetidin-3-yl]-1,2-dimethylpiperazine (PubChem CID 118162414) has the molecular formula C19H31FN4O2
and a molecular weight of 366.48 g/mol. Its IUPAC name is (2R)-4-[1-[6-(diethoxymethyl)-3-fluoro-2-pyridinyl]azetidin-3-yl]-1,2-dimethylpiperazine.
Molecular Properties
| Compound Name | (2R)-4-[1-[6-(diethoxymethyl)-3-fluoro-2-pyridinyl]azetidin-3-yl]-1,2-dimethylpiperazine |
| PubChem CID | 118162414 |
| Molecular Formula | C19H31FN4O2 |
| Molecular Weight | 366.48 g/mol |
| Exact Mass | 366.24 |
| IUPAC Name | (2R)-4-[1-[6-(diethoxymethyl)-3-fluoro-2-pyridinyl]azetidin-3-yl]-1,2-dimethylpiperazine |
| SMILES | CCOC(OCC)c1ccc(F)c(N2CC(N3CCN(C)[C@H](C)C3)C2)n1 |
| InChI | InChI=1S/C19H31FN4O2/c1-5-25-19(26-6-2)17-8-7-16(20)18(21-17)24-12-15(13-24)23-10-9-22(4)14(3)11-23/h7-8,14-15,19H,5-6,9-13H2,1-4H3/t14-/m1/s1 |
| InChIKey | OSPIFMYVWOUNGY-CQSZACIVSA-N |
| XLogP | 2.12 |
| TPSA | 41.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 366.48 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze (2R)-4-[1-[6-(diethoxymethyl)-3-fluoro-2-pyridinyl]azetidin-3-yl]-1,2-dimethylpiperazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-4-[1-[6-(diethoxymethyl)-3-fluoro-2-pyridinyl]azetidin-3-yl]-1,2-dimethylpiperazine?
The IUPAC name of (2R)-4-[1-[6-(diethoxymethyl)-3-fluoro-2-pyridinyl]azetidin-3-yl]-1,2-dimethylpiperazine (CID 118162414) is (2R)-4-[1-[6-(diethoxymethyl)-3-fluoro-2-pyridinyl]azetidin-3-yl]-1,2-dimethylpiperazine.
What is the SMILES notation for (2R)-4-[1-[6-(diethoxymethyl)-3-fluoro-2-pyridinyl]azetidin-3-yl]-1,2-dimethylpiperazine?
The canonical SMILES for (2R)-4-[1-[6-(diethoxymethyl)-3-fluoro-2-pyridinyl]azetidin-3-yl]-1,2-dimethylpiperazine is CCOC(OCC)c1ccc(F)c(N2CC(N3CCN(C)[C@H](C)C3)C2)n1.
What is the InChIKey of (2R)-4-[1-[6-(diethoxymethyl)-3-fluoro-2-pyridinyl]azetidin-3-yl]-1,2-dimethylpiperazine?
The InChIKey is OSPIFMYVWOUNGY-CQSZACIVSA-N. The full InChI is InChI=1S/C19H31FN4O2/c1-5-25-19(26-6-2)17-8-7-16(20)18(21-17)24-12-15(13-24)23-10-9-22(4)14(3)11-23/h7-8,14-15,19H,5-6,9-13H2,1-4H3/t14-/m1/s1.
What are the key properties of (2R)-4-[1-[6-(diethoxymethyl)-3-fluoro-2-pyridinyl]azetidin-3-yl]-1,2-dimethylpiperazine?
(2R)-4-[1-[6-(diethoxymethyl)-3-fluoro-2-pyridinyl]azetidin-3-yl]-1,2-dimethylpiperazine has a molecular weight of 366.48 g/mol, XLogP of 2.12, 7 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-4-[1-[6-(diethoxymethyl)-3-fluoro-2-pyridinyl]azetidin-3-yl]-1,2-dimethylpiperazine is sourced from PubChem (CID 118162414), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).