C21H36FN5O2 — CID 118162541
N-[[6-[3-[(3R)-3,4-dimethylpiperazin-1-yl]azetidin-1-yl]-5-fluoro-2-pyridinyl]methyl]-2,2-diethoxyethanamine (PubChem CID 118162541) has the molecular formula C21H36FN5O2 and a molecular weight of 409.55 g/mol. Its IUPAC name is N-[[6-[3-[(3R)-3,4-dimethylpiperazin-1-yl]azetidin-1-yl]-5-fluoro-2-pyridinyl]methyl]-2,2-diethoxyethanamine.
| Compound Name | N-[[6-[3-[(3R)-3,4-dimethylpiperazin-1-yl]azetidin-1-yl]-5-fluoro-2-pyridinyl]methyl]-2,2-diethoxyethanamine |
|---|---|
| PubChem CID | 118162541 |
| Molecular Formula | C21H36FN5O2 |
| Molecular Weight | 409.55 g/mol |
| Exact Mass | 409.29 |
| IUPAC Name | N-[[6-[3-[(3R)-3,4-dimethylpiperazin-1-yl]azetidin-1-yl]-5-fluoro-2-pyridinyl]methyl]-2,2-diethoxyethanamine |
| SMILES | CCOC(CNCc1ccc(F)c(N2CC(N3CCN(C)[C@H](C)C3)C2)n1)OCC |
| InChI | InChI=1S/C21H36FN5O2/c1-5-28-20(29-6-2)12-23-11-17-7-8-19(22)21(24-17)27-14-18(15-27)26-10-9-25(4)16(3)13-26/h7-8,16,18,20,23H,5-6,9-15H2,1-4H3/t16-/m1/s1 |
| InChIKey | IZDGUFLSBLKJFC-MRXNPFEDSA-N |
| XLogP | 1.53 |
| TPSA | 53.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.55 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|