C26H24FN9O2 — CID 118162625
N-[4-fluoro-3-[6-(6-piperazin-1-yl-3-pyridinyl)-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl]phenyl]-2,4-dimethyl-1,3-oxazole-5-carboxamide (PubChem CID 118162625) has the molecular formula C26H24FN9O2 and a molecular weight of 513.54 g/mol. Its IUPAC name is N-[4-fluoro-3-[6-(6-piperazin-1-yl-3-pyridinyl)-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl]phenyl]-2,4-dimethyl-1,3-oxazole-5-carboxamide.
| Compound Name | N-[4-fluoro-3-[6-(6-piperazin-1-yl-3-pyridinyl)-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl]phenyl]-2,4-dimethyl-1,3-oxazole-5-carboxamide |
|---|---|
| PubChem CID | 118162625 |
| Molecular Formula | C26H24FN9O2 |
| Molecular Weight | 513.54 g/mol |
| Exact Mass | 513.20 |
| IUPAC Name | N-[4-fluoro-3-[6-(6-piperazin-1-yl-3-pyridinyl)-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl]phenyl]-2,4-dimethyl-1,3-oxazole-5-carboxamide |
| SMILES | Cc1nc(C)c(C(=O)Nc2ccc(F)c(-c3nc4ncc(-c5ccc(N6CCNCC6)nc5)cn4n3)c2)o1 |
| InChI | InChI=1S/C26H24FN9O2/c1-15-23(38-16(2)31-15)25(37)32-19-4-5-21(27)20(11-19)24-33-26-30-13-18(14-36(26)34-24)17-3-6-22(29-12-17)35-9-7-28-8-10-35/h3-6,11-14,28H,7-10H2,1-2H3,(H,32,37) |
| InChIKey | KTDQEQUDQAGYNA-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 126.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.54 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |