C23H22FN7O2 — CID 118162651
N-[4-fluoro-3-[6-(1-methyl-3,6-dihydro-2H-pyridin-4-yl)-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl]phenyl]-2,4-dimethyl-1,3-oxazole-5-carboxamide (PubChem CID 118162651) has the molecular formula C23H22FN7O2 and a molecular weight of 447.47 g/mol. Its IUPAC name is N-[4-fluoro-3-[6-(1-methyl-3,6-dihydro-2H-pyridin-4-yl)-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl]phenyl]-2,4-dimethyl-1,3-oxazole-5-carboxamide.
| Compound Name | N-[4-fluoro-3-[6-(1-methyl-3,6-dihydro-2H-pyridin-4-yl)-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl]phenyl]-2,4-dimethyl-1,3-oxazole-5-carboxamide |
|---|---|
| PubChem CID | 118162651 |
| Molecular Formula | C23H22FN7O2 |
| Molecular Weight | 447.47 g/mol |
| Exact Mass | 447.18 |
| IUPAC Name | N-[4-fluoro-3-[6-(1-methyl-3,6-dihydro-2H-pyridin-4-yl)-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl]phenyl]-2,4-dimethyl-1,3-oxazole-5-carboxamide |
| SMILES | Cc1nc(C)c(C(=O)Nc2ccc(F)c(-c3nc4ncc(C5=CCN(C)CC5)cn4n3)c2)o1 |
| InChI | InChI=1S/C23H22FN7O2/c1-13-20(33-14(2)26-13)22(32)27-17-4-5-19(24)18(10-17)21-28-23-25-11-16(12-31(23)29-21)15-6-8-30(3)9-7-15/h4-6,10-12H,7-9H2,1-3H3,(H,27,32) |
| InChIKey | HNKWCMPOPKNVAV-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 101.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.47 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |