C29H28FN7O3 — CID 118162702
N-[4-fluoro-3-[6-[4-(2-morpholin-4-ylethyl)phenyl]-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl]phenyl]-2,4-dimethyl-1,3-oxazole-5-carboxamide (PubChem CID 118162702) has the molecular formula C29H28FN7O3 and a molecular weight of 541.59 g/mol. Its IUPAC name is N-[4-fluoro-3-[6-[4-(2-morpholin-4-ylethyl)phenyl]-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl]phenyl]-2,4-dimethyl-1,3-oxazole-5-carboxamide.
| Compound Name | N-[4-fluoro-3-[6-[4-(2-morpholin-4-ylethyl)phenyl]-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl]phenyl]-2,4-dimethyl-1,3-oxazole-5-carboxamide |
|---|---|
| PubChem CID | 118162702 |
| Molecular Formula | C29H28FN7O3 |
| Molecular Weight | 541.59 g/mol |
| Exact Mass | 541.22 |
| IUPAC Name | N-[4-fluoro-3-[6-[4-(2-morpholin-4-ylethyl)phenyl]-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl]phenyl]-2,4-dimethyl-1,3-oxazole-5-carboxamide |
| SMILES | Cc1nc(C)c(C(=O)Nc2ccc(F)c(-c3nc4ncc(-c5ccc(CCN6CCOCC6)cc5)cn4n3)c2)o1 |
| InChI | InChI=1S/C29H28FN7O3/c1-18-26(40-19(2)32-18)28(38)33-23-7-8-25(30)24(15-23)27-34-29-31-16-22(17-37(29)35-27)21-5-3-20(4-6-21)9-10-36-11-13-39-14-12-36/h3-8,15-17H,9-14H2,1-2H3,(H,33,38) |
| InChIKey | KFGNAVPYMJQPTP-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 110.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.59 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |