C26H23FN8O3 — CID 118162709
N-[4-fluoro-3-[6-(6-morpholin-4-yl-3-pyridinyl)-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl]phenyl]-2,4-dimethyl-1,3-oxazole-5-carboxamide (PubChem CID 118162709) has the molecular formula C26H23FN8O3 and a molecular weight of 514.52 g/mol. Its IUPAC name is N-[4-fluoro-3-[6-(6-morpholin-4-yl-3-pyridinyl)-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl]phenyl]-2,4-dimethyl-1,3-oxazole-5-carboxamide.
| Compound Name | N-[4-fluoro-3-[6-(6-morpholin-4-yl-3-pyridinyl)-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl]phenyl]-2,4-dimethyl-1,3-oxazole-5-carboxamide |
|---|---|
| PubChem CID | 118162709 |
| Molecular Formula | C26H23FN8O3 |
| Molecular Weight | 514.52 g/mol |
| Exact Mass | 514.19 |
| IUPAC Name | N-[4-fluoro-3-[6-(6-morpholin-4-yl-3-pyridinyl)-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl]phenyl]-2,4-dimethyl-1,3-oxazole-5-carboxamide |
| SMILES | Cc1nc(C)c(C(=O)Nc2ccc(F)c(-c3nc4ncc(-c5ccc(N6CCOCC6)nc5)cn4n3)c2)o1 |
| InChI | InChI=1S/C26H23FN8O3/c1-15-23(38-16(2)30-15)25(36)31-19-4-5-21(27)20(11-19)24-32-26-29-13-18(14-35(26)33-24)17-3-6-22(28-12-17)34-7-9-37-10-8-34/h3-6,11-14H,7-10H2,1-2H3,(H,31,36) |
| InChIKey | YFLCTPSABGPJEO-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 123.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.52 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |