C26H24FN7O3 — CID 118162769
N-[2-[7-fluoro-2-[[6-[2-(hydroxymethyl)morpholin-4-yl]-3-pyridinyl]amino]quinazolin-8-yl]-4-pyridinyl]prop-2-enamide (PubChem CID 118162769) has the molecular formula C26H24FN7O3 and a molecular weight of 501.52 g/mol. Its IUPAC name is N-[2-[7-fluoro-2-[[6-[2-(hydroxymethyl)morpholin-4-yl]-3-pyridinyl]amino]quinazolin-8-yl]-4-pyridinyl]prop-2-enamide.
| Compound Name | N-[2-[7-fluoro-2-[[6-[2-(hydroxymethyl)morpholin-4-yl]-3-pyridinyl]amino]quinazolin-8-yl]-4-pyridinyl]prop-2-enamide |
|---|---|
| PubChem CID | 118162769 |
| Molecular Formula | C26H24FN7O3 |
| Molecular Weight | 501.52 g/mol |
| Exact Mass | 501.19 |
| IUPAC Name | N-[2-[7-fluoro-2-[[6-[2-(hydroxymethyl)morpholin-4-yl]-3-pyridinyl]amino]quinazolin-8-yl]-4-pyridinyl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1ccnc(-c2c(F)ccc3cnc(Nc4ccc(N5CCOC(CO)C5)nc4)nc23)c1 |
| InChI | InChI=1S/C26H24FN7O3/c1-2-23(36)31-17-7-8-28-21(11-17)24-20(27)5-3-16-12-30-26(33-25(16)24)32-18-4-6-22(29-13-18)34-9-10-37-19(14-34)15-35/h2-8,11-13,19,35H,1,9-10,14-15H2,(H,28,31,36)(H,30,32,33) |
| InChIKey | LUUPPKBZXCXPAA-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 125.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.52 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|