About methyl 2-(2,3-dihydro-1H-indol-3-yl)acetate
methyl 2-(2,3-dihydro-1H-indol-3-yl)acetate (PubChem CID 11816349) has the molecular formula C11H13NO2
and a molecular weight of 191.23 g/mol. Its IUPAC name is methyl 2-(2,3-dihydro-1H-indol-3-yl)acetate.
Molecular Properties
| Compound Name | methyl 2-(2,3-dihydro-1H-indol-3-yl)acetate |
| PubChem CID | 11816349 |
| Molecular Formula | C11H13NO2 |
| Molecular Weight | 191.23 g/mol |
| Exact Mass | 191.09 |
| IUPAC Name | methyl 2-(2,3-dihydro-1H-indol-3-yl)acetate |
| SMILES | COC(=O)CC1CNc2ccccc21 |
| InChI | InChI=1S/C11H13NO2/c1-14-11(13)6-8-7-12-10-5-3-2-4-9(8)10/h2-5,8,12H,6-7H2,1H3 |
| InChIKey | VWTSSZDILHAHFN-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 191.23 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze methyl 2-(2,3-dihydro-1H-indol-3-yl)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-(2,3-dihydro-1H-indol-3-yl)acetate?
The IUPAC name of methyl 2-(2,3-dihydro-1H-indol-3-yl)acetate (CID 11816349) is methyl 2-(2,3-dihydro-1H-indol-3-yl)acetate.
What is the SMILES notation for methyl 2-(2,3-dihydro-1H-indol-3-yl)acetate?
The canonical SMILES for methyl 2-(2,3-dihydro-1H-indol-3-yl)acetate is COC(=O)CC1CNc2ccccc21.
What is the InChIKey of methyl 2-(2,3-dihydro-1H-indol-3-yl)acetate?
The InChIKey is VWTSSZDILHAHFN-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13NO2/c1-14-11(13)6-8-7-12-10-5-3-2-4-9(8)10/h2-5,8,12H,6-7H2,1H3.
What are the key properties of methyl 2-(2,3-dihydro-1H-indol-3-yl)acetate?
methyl 2-(2,3-dihydro-1H-indol-3-yl)acetate has a molecular weight of 191.23 g/mol, XLogP of 1.76, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-(2,3-dihydro-1H-indol-3-yl)acetate is sourced from PubChem (CID 11816349), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).