C12H17NO — CID 11816354
N,N-dimethyl-2-[(E)-2-phenylethenoxy]ethanamine (PubChem CID 11816354) has the molecular formula C12H17NO and a molecular weight of 191.27 g/mol. Its IUPAC name is N,N-dimethyl-2-[(E)-2-phenylethenoxy]ethanamine.
| Compound Name | N,N-dimethyl-2-[(E)-2-phenylethenoxy]ethanamine |
|---|---|
| PubChem CID | 11816354 |
| Molecular Formula | C12H17NO |
| Molecular Weight | 191.27 g/mol |
| Exact Mass | 191.13 |
| IUPAC Name | N,N-dimethyl-2-[(E)-2-phenylethenoxy]ethanamine |
| SMILES | CN(C)CCO/C=C/c1ccccc1 |
| InChI | InChI=1S/C12H17NO/c1-13(2)9-11-14-10-8-12-6-4-3-5-7-12/h3-8,10H,9,11H2,1-2H3/b10-8+ |
| InChIKey | XMGREXCXPFEQPM-CSKARUKUSA-N |
| XLogP | 2.24 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.27 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|