About 3-methyl-1-azabicyclo[2.2.0]hexane;piperidine
3-methyl-1-azabicyclo[2.2.0]hexane;piperidine (PubChem CID 118163643) has the molecular formula C11H22N2
and a molecular weight of 182.31 g/mol. Its IUPAC name is 3-methyl-1-azabicyclo[2.2.0]hexane;piperidine.
Molecular Properties
| Compound Name | 3-methyl-1-azabicyclo[2.2.0]hexane;piperidine |
| PubChem CID | 118163643 |
| Molecular Formula | C11H22N2 |
| Molecular Weight | 182.31 g/mol |
| Exact Mass | 182.18 |
| IUPAC Name | 3-methyl-1-azabicyclo[2.2.0]hexane;piperidine |
| SMILES | C1CCNCC1.CC1CN2CCC12 |
| InChI | InChI=1S/C6H11N.C5H11N/c1-5-4-7-3-2-6(5)7;1-2-4-6-5-3-1/h5-6H,2-4H2,1H3;6H,1-5H2 |
| InChIKey | YGBSSFOJCJYPKU-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.31 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-methyl-1-azabicyclo[2.2.0]hexane;piperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methyl-1-azabicyclo[2.2.0]hexane;piperidine?
The IUPAC name of 3-methyl-1-azabicyclo[2.2.0]hexane;piperidine (CID 118163643) is 3-methyl-1-azabicyclo[2.2.0]hexane;piperidine.
What is the SMILES notation for 3-methyl-1-azabicyclo[2.2.0]hexane;piperidine?
The canonical SMILES for 3-methyl-1-azabicyclo[2.2.0]hexane;piperidine is C1CCNCC1.CC1CN2CCC12.
What is the InChIKey of 3-methyl-1-azabicyclo[2.2.0]hexane;piperidine?
The InChIKey is YGBSSFOJCJYPKU-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H11N.C5H11N/c1-5-4-7-3-2-6(5)7;1-2-4-6-5-3-1/h5-6H,2-4H2,1H3;6H,1-5H2.
What are the key properties of 3-methyl-1-azabicyclo[2.2.0]hexane;piperidine?
3-methyl-1-azabicyclo[2.2.0]hexane;piperidine has a molecular weight of 182.31 g/mol, XLogP of 1.47, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methyl-1-azabicyclo[2.2.0]hexane;piperidine is sourced from PubChem (CID 118163643), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).