About 2-phenylmethoxybutanoic acid
2-phenylmethoxybutanoic acid (PubChem CID 11816388) has the molecular formula C11H14O3
and a molecular weight of 194.23 g/mol. Its IUPAC name is 2-phenylmethoxybutanoic acid.
Molecular Properties
| Compound Name | 2-phenylmethoxybutanoic acid |
| PubChem CID | 11816388 |
| Molecular Formula | C11H14O3 |
| Molecular Weight | 194.23 g/mol |
| Exact Mass | 194.09 |
| IUPAC Name | 2-phenylmethoxybutanoic acid |
| SMILES | CCC(OCc1ccccc1)C(=O)O |
| InChI | InChI=1S/C11H14O3/c1-2-10(11(12)13)14-8-9-6-4-3-5-7-9/h3-7,10H,2,8H2,1H3,(H,12,13) |
| InChIKey | HNLVMIYYKOKWEH-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.23 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-phenylmethoxybutanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-phenylmethoxybutanoic acid?
The IUPAC name of 2-phenylmethoxybutanoic acid (CID 11816388) is 2-phenylmethoxybutanoic acid.
What is the SMILES notation for 2-phenylmethoxybutanoic acid?
The canonical SMILES for 2-phenylmethoxybutanoic acid is CCC(OCc1ccccc1)C(=O)O.
What is the InChIKey of 2-phenylmethoxybutanoic acid?
The InChIKey is HNLVMIYYKOKWEH-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14O3/c1-2-10(11(12)13)14-8-9-6-4-3-5-7-9/h3-7,10H,2,8H2,1H3,(H,12,13).
What are the key properties of 2-phenylmethoxybutanoic acid?
2-phenylmethoxybutanoic acid has a molecular weight of 194.23 g/mol, XLogP of 2.07, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-phenylmethoxybutanoic acid is sourced from PubChem (CID 11816388), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).