C11H14O3 — CID 11816389
(1R,2S,3R,4S)-3-propanoylbicyclo[2.2.1]hept-5-ene-2-carboxylic acid (PubChem CID 11816389) has the molecular formula C11H14O3 and a molecular weight of 194.23 g/mol. Its IUPAC name is (1R,2S,3R,4S)-3-propanoylbicyclo[2.2.1]hept-5-ene-2-carboxylic acid.
| Compound Name | (1R,2S,3R,4S)-3-propanoylbicyclo[2.2.1]hept-5-ene-2-carboxylic acid |
|---|---|
| PubChem CID | 11816389 |
| Molecular Formula | C11H14O3 |
| Molecular Weight | 194.23 g/mol |
| Exact Mass | 194.09 |
| IUPAC Name | (1R,2S,3R,4S)-3-propanoylbicyclo[2.2.1]hept-5-ene-2-carboxylic acid |
| SMILES | CCC(=O)[C@H]1[C@@H](C(=O)O)[C@H]2C=C[C@@H]1C2 |
| InChI | InChI=1S/C11H14O3/c1-2-8(12)9-6-3-4-7(5-6)10(9)11(13)14/h3-4,6-7,9-10H,2,5H2,1H3,(H,13,14)/t6-,7+,9+,10+/m1/s1 |
| InChIKey | JKBMWUROTJVDHI-KKHAAJSZSA-N |
| XLogP | 1.49 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.23 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|