About 5-[1-(2,6-difluorophenyl)-6-methoxyindazol-5-yl]-1-methylpyrazole-3-carboxylic acid
5-[1-(2,6-difluorophenyl)-6-methoxyindazol-5-yl]-1-methylpyrazole-3-carboxylic acid (PubChem CID 118163899) has the molecular formula C19H14F2N4O3
and a molecular weight of 384.34 g/mol. Its IUPAC name is 5-[1-(2,6-difluorophenyl)-6-methoxyindazol-5-yl]-1-methylpyrazole-3-carboxylic acid.
Molecular Properties
| Compound Name | 5-[1-(2,6-difluorophenyl)-6-methoxyindazol-5-yl]-1-methylpyrazole-3-carboxylic acid |
| PubChem CID | 118163899 |
| Molecular Formula | C19H14F2N4O3 |
| Molecular Weight | 384.34 g/mol |
| Exact Mass | 384.10 |
| IUPAC Name | 5-[1-(2,6-difluorophenyl)-6-methoxyindazol-5-yl]-1-methylpyrazole-3-carboxylic acid |
| SMILES | COc1cc2c(cnn2-c2c(F)cccc2F)cc1-c1cc(C(=O)O)nn1C |
| InChI | InChI=1S/C19H14F2N4O3/c1-24-16(7-14(23-24)19(26)27)11-6-10-9-22-25(15(10)8-17(11)28-2)18-12(20)4-3-5-13(18)21/h3-9H,1-2H3,(H,26,27) |
| InChIKey | UJZUFLMENDVTHK-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 82.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 384.34 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 5-[1-(2,6-difluorophenyl)-6-methoxyindazol-5-yl]-1-methylpyrazole-3-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[1-(2,6-difluorophenyl)-6-methoxyindazol-5-yl]-1-methylpyrazole-3-carboxylic acid?
The IUPAC name of 5-[1-(2,6-difluorophenyl)-6-methoxyindazol-5-yl]-1-methylpyrazole-3-carboxylic acid (CID 118163899) is 5-[1-(2,6-difluorophenyl)-6-methoxyindazol-5-yl]-1-methylpyrazole-3-carboxylic acid.
What is the SMILES notation for 5-[1-(2,6-difluorophenyl)-6-methoxyindazol-5-yl]-1-methylpyrazole-3-carboxylic acid?
The canonical SMILES for 5-[1-(2,6-difluorophenyl)-6-methoxyindazol-5-yl]-1-methylpyrazole-3-carboxylic acid is COc1cc2c(cnn2-c2c(F)cccc2F)cc1-c1cc(C(=O)O)nn1C.
What is the InChIKey of 5-[1-(2,6-difluorophenyl)-6-methoxyindazol-5-yl]-1-methylpyrazole-3-carboxylic acid?
The InChIKey is UJZUFLMENDVTHK-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H14F2N4O3/c1-24-16(7-14(23-24)19(26)27)11-6-10-9-22-25(15(10)8-17(11)28-2)18-12(20)4-3-5-13(18)21/h3-9H,1-2H3,(H,26,27).
What are the key properties of 5-[1-(2,6-difluorophenyl)-6-methoxyindazol-5-yl]-1-methylpyrazole-3-carboxylic acid?
5-[1-(2,6-difluorophenyl)-6-methoxyindazol-5-yl]-1-methylpyrazole-3-carboxylic acid has a molecular weight of 384.34 g/mol, XLogP of 3.41, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[1-(2,6-difluorophenyl)-6-methoxyindazol-5-yl]-1-methylpyrazole-3-carboxylic acid is sourced from PubChem (CID 118163899), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).