C23H17ClFN3O5S — CID 118164907
2-[[(2S)-6-amino-8-chloro-4-(4-fluorophenyl)sulfonyl-2,3-dihydro-1,4-benzoxazin-2-yl]methyl]isoindole-1,3-dione (PubChem CID 118164907) has the molecular formula C23H17ClFN3O5S and a molecular weight of 501.92 g/mol. Its IUPAC name is 2-[[(2S)-6-amino-8-chloro-4-(4-fluorophenyl)sulfonyl-2,3-dihydro-1,4-benzoxazin-2-yl]methyl]isoindole-1,3-dione.
| Compound Name | 2-[[(2S)-6-amino-8-chloro-4-(4-fluorophenyl)sulfonyl-2,3-dihydro-1,4-benzoxazin-2-yl]methyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 118164907 |
| Molecular Formula | C23H17ClFN3O5S |
| Molecular Weight | 501.92 g/mol |
| Exact Mass | 501.06 |
| IUPAC Name | 2-[[(2S)-6-amino-8-chloro-4-(4-fluorophenyl)sulfonyl-2,3-dihydro-1,4-benzoxazin-2-yl]methyl]isoindole-1,3-dione |
| SMILES | Nc1cc(Cl)c2c(c1)N(S(=O)(=O)c1ccc(F)cc1)C[C@H](CN1C(=O)c3ccccc3C1=O)O2 |
| InChI | InChI=1S/C23H17ClFN3O5S/c24-19-9-14(26)10-20-21(19)33-15(11-27-22(29)17-3-1-2-4-18(17)23(27)30)12-28(20)34(31,32)16-7-5-13(25)6-8-16/h1-10,15H,11-12,26H2/t15-/m0/s1 |
| InChIKey | KTGWYSJVNAPHEI-HNNXBMFYSA-N |
| XLogP | 3.31 |
| TPSA | 110.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.92 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|