About 4-bromo-5-ethyl-2,3-dihydropyran-6-one
4-bromo-5-ethyl-2,3-dihydropyran-6-one (PubChem CID 11816565) has the molecular formula C7H9BrO2
and a molecular weight of 205.05 g/mol. Its IUPAC name is 4-bromo-5-ethyl-2,3-dihydropyran-6-one.
Molecular Properties
| Compound Name | 4-bromo-5-ethyl-2,3-dihydropyran-6-one |
| PubChem CID | 11816565 |
| Molecular Formula | C7H9BrO2 |
| Molecular Weight | 205.05 g/mol |
| Exact Mass | 203.98 |
| IUPAC Name | 4-bromo-5-ethyl-2,3-dihydropyran-6-one |
| SMILES | CCC1=C(Br)CCOC1=O |
| InChI | InChI=1S/C7H9BrO2/c1-2-5-6(8)3-4-10-7(5)9/h2-4H2,1H3 |
| InChIKey | ACDZZUJOFGYJEL-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 205.05 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-bromo-5-ethyl-2,3-dihydropyran-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-bromo-5-ethyl-2,3-dihydropyran-6-one?
The IUPAC name of 4-bromo-5-ethyl-2,3-dihydropyran-6-one (CID 11816565) is 4-bromo-5-ethyl-2,3-dihydropyran-6-one.
What is the SMILES notation for 4-bromo-5-ethyl-2,3-dihydropyran-6-one?
The canonical SMILES for 4-bromo-5-ethyl-2,3-dihydropyran-6-one is CCC1=C(Br)CCOC1=O.
What is the InChIKey of 4-bromo-5-ethyl-2,3-dihydropyran-6-one?
The InChIKey is ACDZZUJOFGYJEL-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9BrO2/c1-2-5-6(8)3-4-10-7(5)9/h2-4H2,1H3.
What are the key properties of 4-bromo-5-ethyl-2,3-dihydropyran-6-one?
4-bromo-5-ethyl-2,3-dihydropyran-6-one has a molecular weight of 205.05 g/mol, XLogP of 1.99, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-bromo-5-ethyl-2,3-dihydropyran-6-one is sourced from PubChem (CID 11816565), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).