C25H31N5O3S — CID 118165819
cis-(1S,4R)-4-[5-[3-[(1-cyclobutyl-1,2,4-triazol-3-yl)amino]-5-methylphenyl]-1,3-thiazol-2-yl]-4-hydroxy-2,2-dimethylcyclohexane-1-carboxylic acid (PubChem CID 118165819) has the molecular formula C25H31N5O3S and a molecular weight of 481.62 g/mol. Its IUPAC name is cis-(1S,4R)-4-[5-[3-[(1-cyclobutyl-1,2,4-triazol-3-yl)amino]-5-methylphenyl]-1,3-thiazol-2-yl]-4-hydroxy-2,2-dimethylcyclohexane-1-carboxylic acid.
| Compound Name | cis-(1S,4R)-4-[5-[3-[(1-cyclobutyl-1,2,4-triazol-3-yl)amino]-5-methylphenyl]-1,3-thiazol-2-yl]-4-hydroxy-2,2-dimethylcyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 118165819 |
| Molecular Formula | C25H31N5O3S |
| Molecular Weight | 481.62 g/mol |
| Exact Mass | 481.21 |
| IUPAC Name | cis-(1S,4R)-4-[5-[3-[(1-cyclobutyl-1,2,4-triazol-3-yl)amino]-5-methylphenyl]-1,3-thiazol-2-yl]-4-hydroxy-2,2-dimethylcyclohexane-1-carboxylic acid |
| SMILES | Cc1cc(Nc2ncn(C3CCC3)n2)cc(-c2cnc([C@@]3(O)CC[C@H](C(=O)O)C(C)(C)C3)s2)c1 |
| InChI | InChI=1S/C25H31N5O3S/c1-15-9-16(11-17(10-15)28-23-27-14-30(29-23)18-5-4-6-18)20-12-26-22(34-20)25(33)8-7-19(21(31)32)24(2,3)13-25/h9-12,14,18-19,33H,4-8,13H2,1-3H3,(H,28,29)(H,31,32)/t19-,25-/m1/s1 |
| InChIKey | LPAJKKSMMOCYBU-KBMIEXCESA-N |
| XLogP | 5.28 |
| TPSA | 113.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.62 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |