About 3-(3-aminoazetidin-1-yl)-6-chloro-1,2,4-triazin-5-amine
3-(3-aminoazetidin-1-yl)-6-chloro-1,2,4-triazin-5-amine (PubChem CID 118165976) has the molecular formula C6H9ClN6
and a molecular weight of 200.63 g/mol. Its IUPAC name is 3-(3-aminoazetidin-1-yl)-6-chloro-1,2,4-triazin-5-amine.
Molecular Properties
| Compound Name | 3-(3-aminoazetidin-1-yl)-6-chloro-1,2,4-triazin-5-amine |
| PubChem CID | 118165976 |
| Molecular Formula | C6H9ClN6 |
| Molecular Weight | 200.63 g/mol |
| Exact Mass | 200.06 |
| IUPAC Name | 3-(3-aminoazetidin-1-yl)-6-chloro-1,2,4-triazin-5-amine |
| SMILES | Nc1nc(N2CC(N)C2)nnc1Cl |
| InChI | InChI=1S/C6H9ClN6/c7-4-5(9)10-6(12-11-4)13-1-3(8)2-13/h3H,1-2,8H2,(H2,9,10,12) |
| InChIKey | VTKGKQVDWUWOCG-UHFFFAOYSA-N |
| XLogP | -0.75 |
| TPSA | 93.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.63 |
| LogP ≤ 5 | -0.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 3-(3-aminoazetidin-1-yl)-6-chloro-1,2,4-triazin-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(3-aminoazetidin-1-yl)-6-chloro-1,2,4-triazin-5-amine?
The IUPAC name of 3-(3-aminoazetidin-1-yl)-6-chloro-1,2,4-triazin-5-amine (CID 118165976) is 3-(3-aminoazetidin-1-yl)-6-chloro-1,2,4-triazin-5-amine.
What is the SMILES notation for 3-(3-aminoazetidin-1-yl)-6-chloro-1,2,4-triazin-5-amine?
The canonical SMILES for 3-(3-aminoazetidin-1-yl)-6-chloro-1,2,4-triazin-5-amine is Nc1nc(N2CC(N)C2)nnc1Cl.
What is the InChIKey of 3-(3-aminoazetidin-1-yl)-6-chloro-1,2,4-triazin-5-amine?
The InChIKey is VTKGKQVDWUWOCG-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9ClN6/c7-4-5(9)10-6(12-11-4)13-1-3(8)2-13/h3H,1-2,8H2,(H2,9,10,12).
What are the key properties of 3-(3-aminoazetidin-1-yl)-6-chloro-1,2,4-triazin-5-amine?
3-(3-aminoazetidin-1-yl)-6-chloro-1,2,4-triazin-5-amine has a molecular weight of 200.63 g/mol, XLogP of -0.75, 1 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3-aminoazetidin-1-yl)-6-chloro-1,2,4-triazin-5-amine is sourced from PubChem (CID 118165976), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).