C16H19Cl2F3N6O — CID 118166042
3-[2-[[5-amino-6-(2,3-dichlorophenyl)-1,2,4-triazin-3-yl]-methylamino]ethyl-methylamino]-1,1,1-trifluoropropan-2-ol (PubChem CID 118166042) has the molecular formula C16H19Cl2F3N6O and a molecular weight of 439.27 g/mol. Its IUPAC name is 3-[2-[[5-amino-6-(2,3-dichlorophenyl)-1,2,4-triazin-3-yl]-methylamino]ethyl-methylamino]-1,1,1-trifluoropropan-2-ol.
| Compound Name | 3-[2-[[5-amino-6-(2,3-dichlorophenyl)-1,2,4-triazin-3-yl]-methylamino]ethyl-methylamino]-1,1,1-trifluoropropan-2-ol |
|---|---|
| PubChem CID | 118166042 |
| Molecular Formula | C16H19Cl2F3N6O |
| Molecular Weight | 439.27 g/mol |
| Exact Mass | 438.09 |
| IUPAC Name | 3-[2-[[5-amino-6-(2,3-dichlorophenyl)-1,2,4-triazin-3-yl]-methylamino]ethyl-methylamino]-1,1,1-trifluoropropan-2-ol |
| SMILES | CN(CCN(C)c1nnc(-c2cccc(Cl)c2Cl)c(N)n1)CC(O)C(F)(F)F |
| InChI | InChI=1S/C16H19Cl2F3N6O/c1-26(8-11(28)16(19,20)21)6-7-27(2)15-23-14(22)13(24-25-15)9-4-3-5-10(17)12(9)18/h3-5,11,28H,6-8H2,1-2H3,(H2,22,23,25) |
| InChIKey | MZILTZQGQCCJLP-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 91.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.27 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |