C15H17Cl2F3N6O — CID 118166045
(2S)-3-[2-[[5-amino-6-(2,3-dichlorophenyl)-1,2,4-triazin-3-yl]amino]ethyl-methylamino]-1,1,1-trifluoropropan-2-ol (PubChem CID 118166045) has the molecular formula C15H17Cl2F3N6O and a molecular weight of 425.24 g/mol. Its IUPAC name is (2S)-3-[2-[[5-amino-6-(2,3-dichlorophenyl)-1,2,4-triazin-3-yl]amino]ethyl-methylamino]-1,1,1-trifluoropropan-2-ol.
| Compound Name | (2S)-3-[2-[[5-amino-6-(2,3-dichlorophenyl)-1,2,4-triazin-3-yl]amino]ethyl-methylamino]-1,1,1-trifluoropropan-2-ol |
|---|---|
| PubChem CID | 118166045 |
| Molecular Formula | C15H17Cl2F3N6O |
| Molecular Weight | 425.24 g/mol |
| Exact Mass | 424.08 |
| IUPAC Name | (2S)-3-[2-[[5-amino-6-(2,3-dichlorophenyl)-1,2,4-triazin-3-yl]amino]ethyl-methylamino]-1,1,1-trifluoropropan-2-ol |
| SMILES | CN(CCNc1nnc(-c2cccc(Cl)c2Cl)c(N)n1)C[C@H](O)C(F)(F)F |
| InChI | InChI=1S/C15H17Cl2F3N6O/c1-26(7-10(27)15(18,19)20)6-5-22-14-23-13(21)12(24-25-14)8-3-2-4-9(16)11(8)17/h2-4,10,27H,5-7H2,1H3,(H3,21,22,23,25)/t10-/m0/s1 |
| InChIKey | GDGHKVFAYMYSJG-JTQLQIEISA-N |
| XLogP | 2.69 |
| TPSA | 100.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.24 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |