C10H18ClN5O3 — CID 118166048
2-[(5-amino-6-chloro-1,2,4-triazin-3-yl)amino]-3-(2-methoxyethoxy)-2-methylpropan-1-ol (PubChem CID 118166048) has the molecular formula C10H18ClN5O3 and a molecular weight of 291.74 g/mol. Its IUPAC name is 2-[(5-amino-6-chloro-1,2,4-triazin-3-yl)amino]-3-(2-methoxyethoxy)-2-methylpropan-1-ol.
| Compound Name | 2-[(5-amino-6-chloro-1,2,4-triazin-3-yl)amino]-3-(2-methoxyethoxy)-2-methylpropan-1-ol |
|---|---|
| PubChem CID | 118166048 |
| Molecular Formula | C10H18ClN5O3 |
| Molecular Weight | 291.74 g/mol |
| Exact Mass | 291.11 |
| IUPAC Name | 2-[(5-amino-6-chloro-1,2,4-triazin-3-yl)amino]-3-(2-methoxyethoxy)-2-methylpropan-1-ol |
| SMILES | COCCOCC(C)(CO)Nc1nnc(Cl)c(N)n1 |
| InChI | InChI=1S/C10H18ClN5O3/c1-10(5-17,6-19-4-3-18-2)14-9-13-8(12)7(11)15-16-9/h17H,3-6H2,1-2H3,(H3,12,13,14,16) |
| InChIKey | VPWMCBTVLJMTKD-UHFFFAOYSA-N |
| XLogP | -0.07 |
| TPSA | 115.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.74 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|