C9H16ClN5O2 — CID 118166083
2-[2-[(5-amino-6-chloro-1,2,4-triazin-3-yl)amino]-2-methylpropoxy]ethanol (PubChem CID 118166083) has the molecular formula C9H16ClN5O2 and a molecular weight of 261.71 g/mol. Its IUPAC name is 2-[2-[(5-amino-6-chloro-1,2,4-triazin-3-yl)amino]-2-methylpropoxy]ethanol.
| Compound Name | 2-[2-[(5-amino-6-chloro-1,2,4-triazin-3-yl)amino]-2-methylpropoxy]ethanol |
|---|---|
| PubChem CID | 118166083 |
| Molecular Formula | C9H16ClN5O2 |
| Molecular Weight | 261.71 g/mol |
| Exact Mass | 261.10 |
| IUPAC Name | 2-[2-[(5-amino-6-chloro-1,2,4-triazin-3-yl)amino]-2-methylpropoxy]ethanol |
| SMILES | CC(C)(COCCO)Nc1nnc(Cl)c(N)n1 |
| InChI | InChI=1S/C9H16ClN5O2/c1-9(2,5-17-4-3-16)13-8-12-7(11)6(10)14-15-8/h16H,3-5H2,1-2H3,(H3,11,12,13,15) |
| InChIKey | OKUCVJDBQRTPTB-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 106.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.71 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|