C16H18Cl2F3N5O3 — CID 118166210
6-(3,4-dichlorophenyl)-3-N-[2-[2-[2-(trifluoromethoxy)ethoxy]ethoxy]ethyl]-1,2,4-triazine-3,5-diamine (PubChem CID 118166210) has the molecular formula C16H18Cl2F3N5O3 and a molecular weight of 456.25 g/mol. Its IUPAC name is 6-(3,4-dichlorophenyl)-3-N-[2-[2-[2-(trifluoromethoxy)ethoxy]ethoxy]ethyl]-1,2,4-triazine-3,5-diamine.
| Compound Name | 6-(3,4-dichlorophenyl)-3-N-[2-[2-[2-(trifluoromethoxy)ethoxy]ethoxy]ethyl]-1,2,4-triazine-3,5-diamine |
|---|---|
| PubChem CID | 118166210 |
| Molecular Formula | C16H18Cl2F3N5O3 |
| Molecular Weight | 456.25 g/mol |
| Exact Mass | 455.07 |
| IUPAC Name | 6-(3,4-dichlorophenyl)-3-N-[2-[2-[2-(trifluoromethoxy)ethoxy]ethoxy]ethyl]-1,2,4-triazine-3,5-diamine |
| SMILES | Nc1nc(NCCOCCOCCOC(F)(F)F)nnc1-c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C16H18Cl2F3N5O3/c17-11-2-1-10(9-12(11)18)13-14(22)24-15(26-25-13)23-3-4-27-5-6-28-7-8-29-16(19,20)21/h1-2,9H,3-8H2,(H3,22,23,24,26) |
| InChIKey | JYQXRGOQPNYHDG-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 104.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.25 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|