C10H18ClN5O2 — CID 118166228
6-chloro-3-N-[1-(2-methoxyethoxy)-2-methylpropan-2-yl]-1,2,4-triazine-3,5-diamine (PubChem CID 118166228) has the molecular formula C10H18ClN5O2 and a molecular weight of 275.74 g/mol. Its IUPAC name is 6-chloro-3-N-[1-(2-methoxyethoxy)-2-methylpropan-2-yl]-1,2,4-triazine-3,5-diamine.
| Compound Name | 6-chloro-3-N-[1-(2-methoxyethoxy)-2-methylpropan-2-yl]-1,2,4-triazine-3,5-diamine |
|---|---|
| PubChem CID | 118166228 |
| Molecular Formula | C10H18ClN5O2 |
| Molecular Weight | 275.74 g/mol |
| Exact Mass | 275.11 |
| IUPAC Name | 6-chloro-3-N-[1-(2-methoxyethoxy)-2-methylpropan-2-yl]-1,2,4-triazine-3,5-diamine |
| SMILES | COCCOCC(C)(C)Nc1nnc(Cl)c(N)n1 |
| InChI | InChI=1S/C10H18ClN5O2/c1-10(2,6-18-5-4-17-3)14-9-13-8(12)7(11)15-16-9/h4-6H2,1-3H3,(H3,12,13,14,16) |
| InChIKey | SQROIQCVKXCVSE-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 95.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.74 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|