About 2-[(5-amino-6-chloro-1,2,4-triazin-3-yl)-methylamino]ethanol
2-[(5-amino-6-chloro-1,2,4-triazin-3-yl)-methylamino]ethanol (PubChem CID 118166235) has the molecular formula C6H10ClN5O
and a molecular weight of 203.63 g/mol. Its IUPAC name is 2-[(5-amino-6-chloro-1,2,4-triazin-3-yl)-methylamino]ethanol.
Molecular Properties
| Compound Name | 2-[(5-amino-6-chloro-1,2,4-triazin-3-yl)-methylamino]ethanol |
| PubChem CID | 118166235 |
| Molecular Formula | C6H10ClN5O |
| Molecular Weight | 203.63 g/mol |
| Exact Mass | 203.06 |
| IUPAC Name | 2-[(5-amino-6-chloro-1,2,4-triazin-3-yl)-methylamino]ethanol |
| SMILES | CN(CCO)c1nnc(Cl)c(N)n1 |
| InChI | InChI=1S/C6H10ClN5O/c1-12(2-3-13)6-9-5(8)4(7)10-11-6/h13H,2-3H2,1H3,(H2,8,9,11) |
| InChIKey | QXOUXSPIEUGKQF-UHFFFAOYSA-N |
| XLogP | -0.46 |
| TPSA | 88.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 203.63 |
| LogP ≤ 5 | -0.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-[(5-amino-6-chloro-1,2,4-triazin-3-yl)-methylamino]ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(5-amino-6-chloro-1,2,4-triazin-3-yl)-methylamino]ethanol?
The IUPAC name of 2-[(5-amino-6-chloro-1,2,4-triazin-3-yl)-methylamino]ethanol (CID 118166235) is 2-[(5-amino-6-chloro-1,2,4-triazin-3-yl)-methylamino]ethanol.
What is the SMILES notation for 2-[(5-amino-6-chloro-1,2,4-triazin-3-yl)-methylamino]ethanol?
The canonical SMILES for 2-[(5-amino-6-chloro-1,2,4-triazin-3-yl)-methylamino]ethanol is CN(CCO)c1nnc(Cl)c(N)n1.
What is the InChIKey of 2-[(5-amino-6-chloro-1,2,4-triazin-3-yl)-methylamino]ethanol?
The InChIKey is QXOUXSPIEUGKQF-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10ClN5O/c1-12(2-3-13)6-9-5(8)4(7)10-11-6/h13H,2-3H2,1H3,(H2,8,9,11).
What are the key properties of 2-[(5-amino-6-chloro-1,2,4-triazin-3-yl)-methylamino]ethanol?
2-[(5-amino-6-chloro-1,2,4-triazin-3-yl)-methylamino]ethanol has a molecular weight of 203.63 g/mol, XLogP of -0.46, 3 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(5-amino-6-chloro-1,2,4-triazin-3-yl)-methylamino]ethanol is sourced from PubChem (CID 118166235), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).