C18H23Cl2F3N6O2 — CID 118166256
(2S)-1-[2-[[5-amino-6-(2,3-dichlorophenyl)-1,2,4-triazin-3-yl]-methylamino]ethyl-methylamino]-3-(2,2,2-trifluoroethoxy)propan-2-ol (PubChem CID 118166256) has the molecular formula C18H23Cl2F3N6O2 and a molecular weight of 483.32 g/mol. Its IUPAC name is (2S)-1-[2-[[5-amino-6-(2,3-dichlorophenyl)-1,2,4-triazin-3-yl]-methylamino]ethyl-methylamino]-3-(2,2,2-trifluoroethoxy)propan-2-ol.
| Compound Name | (2S)-1-[2-[[5-amino-6-(2,3-dichlorophenyl)-1,2,4-triazin-3-yl]-methylamino]ethyl-methylamino]-3-(2,2,2-trifluoroethoxy)propan-2-ol |
|---|---|
| PubChem CID | 118166256 |
| Molecular Formula | C18H23Cl2F3N6O2 |
| Molecular Weight | 483.32 g/mol |
| Exact Mass | 482.12 |
| IUPAC Name | (2S)-1-[2-[[5-amino-6-(2,3-dichlorophenyl)-1,2,4-triazin-3-yl]-methylamino]ethyl-methylamino]-3-(2,2,2-trifluoroethoxy)propan-2-ol |
| SMILES | CN(CCN(C)c1nnc(-c2cccc(Cl)c2Cl)c(N)n1)C[C@H](O)COCC(F)(F)F |
| InChI | InChI=1S/C18H23Cl2F3N6O2/c1-28(8-11(30)9-31-10-18(21,22)23)6-7-29(2)17-25-16(24)15(26-27-17)12-4-3-5-13(19)14(12)20/h3-5,11,30H,6-10H2,1-2H3,(H2,24,25,27)/t11-/m0/s1 |
| InChIKey | NWGKGCQFZUZIOH-NSHDSACASA-N |
| XLogP | 2.74 |
| TPSA | 100.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.32 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |