C15H17Cl2N5O4 — CID 118166347
2-[2-[[5-amino-6-(2,3-dichlorophenyl)-1,2,4-triazin-3-yl]amino]ethoxy]ethyl methyl carbonate (PubChem CID 118166347) has the molecular formula C15H17Cl2N5O4 and a molecular weight of 402.24 g/mol. Its IUPAC name is 2-[2-[[5-amino-6-(2,3-dichlorophenyl)-1,2,4-triazin-3-yl]amino]ethoxy]ethyl methyl carbonate.
| Compound Name | 2-[2-[[5-amino-6-(2,3-dichlorophenyl)-1,2,4-triazin-3-yl]amino]ethoxy]ethyl methyl carbonate |
|---|---|
| PubChem CID | 118166347 |
| Molecular Formula | C15H17Cl2N5O4 |
| Molecular Weight | 402.24 g/mol |
| Exact Mass | 401.07 |
| IUPAC Name | 2-[2-[[5-amino-6-(2,3-dichlorophenyl)-1,2,4-triazin-3-yl]amino]ethoxy]ethyl methyl carbonate |
| SMILES | COC(=O)OCCOCCNc1nnc(-c2cccc(Cl)c2Cl)c(N)n1 |
| InChI | InChI=1S/C15H17Cl2N5O4/c1-24-15(23)26-8-7-25-6-5-19-14-20-13(18)12(21-22-14)9-3-2-4-10(16)11(9)17/h2-4H,5-8H2,1H3,(H3,18,19,20,22) |
| InChIKey | DBNNBOUNMZDADO-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 121.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.24 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|