About 2-methoxy-3,4-dihydroisoquinolin-1-one
2-methoxy-3,4-dihydroisoquinolin-1-one (PubChem CID 118166559) has the molecular formula C10H11NO2
and a molecular weight of 177.20 g/mol. Its IUPAC name is 2-methoxy-3,4-dihydroisoquinolin-1-one.
Molecular Properties
| Compound Name | 2-methoxy-3,4-dihydroisoquinolin-1-one |
| PubChem CID | 118166559 |
| Molecular Formula | C10H11NO2 |
| Molecular Weight | 177.20 g/mol |
| Exact Mass | 177.08 |
| IUPAC Name | 2-methoxy-3,4-dihydroisoquinolin-1-one |
| SMILES | CON1CCc2ccccc2C1=O |
| InChI | InChI=1S/C10H11NO2/c1-13-11-7-6-8-4-2-3-5-9(8)10(11)12/h2-5H,6-7H2,1H3 |
| InChIKey | BFYGWTXKXGLZBY-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 177.20 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-methoxy-3,4-dihydroisoquinolin-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methoxy-3,4-dihydroisoquinolin-1-one?
The IUPAC name of 2-methoxy-3,4-dihydroisoquinolin-1-one (CID 118166559) is 2-methoxy-3,4-dihydroisoquinolin-1-one.
What is the SMILES notation for 2-methoxy-3,4-dihydroisoquinolin-1-one?
The canonical SMILES for 2-methoxy-3,4-dihydroisoquinolin-1-one is CON1CCc2ccccc2C1=O.
What is the InChIKey of 2-methoxy-3,4-dihydroisoquinolin-1-one?
The InChIKey is BFYGWTXKXGLZBY-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11NO2/c1-13-11-7-6-8-4-2-3-5-9(8)10(11)12/h2-5H,6-7H2,1H3.
What are the key properties of 2-methoxy-3,4-dihydroisoquinolin-1-one?
2-methoxy-3,4-dihydroisoquinolin-1-one has a molecular weight of 177.20 g/mol, XLogP of 1.25, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methoxy-3,4-dihydroisoquinolin-1-one is sourced from PubChem (CID 118166559), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).