C18H20F4N4O2 — CID 118166894
(2R)-3,3,3-trifluoro-1-[(3R,4S)-4-[3-(4-fluorophenyl)-1,2,4-triazol-4-yl]-3-methylpiperidin-1-yl]-2-hydroxy-2-methylpropan-1-one (PubChem CID 118166894) has the molecular formula C18H20F4N4O2 and a molecular weight of 400.38 g/mol. Its IUPAC name is (2R)-3,3,3-trifluoro-1-[(3R,4S)-4-[3-(4-fluorophenyl)-1,2,4-triazol-4-yl]-3-methylpiperidin-1-yl]-2-hydroxy-2-methylpropan-1-one.
| Compound Name | (2R)-3,3,3-trifluoro-1-[(3R,4S)-4-[3-(4-fluorophenyl)-1,2,4-triazol-4-yl]-3-methylpiperidin-1-yl]-2-hydroxy-2-methylpropan-1-one |
|---|---|
| PubChem CID | 118166894 |
| Molecular Formula | C18H20F4N4O2 |
| Molecular Weight | 400.38 g/mol |
| Exact Mass | 400.15 |
| IUPAC Name | (2R)-3,3,3-trifluoro-1-[(3R,4S)-4-[3-(4-fluorophenyl)-1,2,4-triazol-4-yl]-3-methylpiperidin-1-yl]-2-hydroxy-2-methylpropan-1-one |
| SMILES | C[C@@H]1CN(C(=O)[C@@](C)(O)C(F)(F)F)CC[C@@H]1n1cnnc1-c1ccc(F)cc1 |
| InChI | InChI=1S/C18H20F4N4O2/c1-11-9-25(16(27)17(2,28)18(20,21)22)8-7-14(11)26-10-23-24-15(26)12-3-5-13(19)6-4-12/h3-6,10-11,14,28H,7-9H2,1-2H3/t11-,14+,17-/m1/s1 |
| InChIKey | RKWGKLGSKYNZAX-HYSWKAIVSA-N |
| XLogP | 2.81 |
| TPSA | 71.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.38 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |