C7H10N4 — CID 118167407
1,4,4a,8a-tetrahydropyrido[2,3-b]pyrazin-7-amine (PubChem CID 118167407) has the molecular formula C7H10N4 and a molecular weight of 150.18 g/mol. Its IUPAC name is 1,4,4a,8a-tetrahydropyrido[2,3-b]pyrazin-7-amine.
| Compound Name | 1,4,4a,8a-tetrahydropyrido[2,3-b]pyrazin-7-amine |
|---|---|
| PubChem CID | 118167407 |
| Molecular Formula | C7H10N4 |
| Molecular Weight | 150.18 g/mol |
| Exact Mass | 150.09 |
| IUPAC Name | 1,4,4a,8a-tetrahydropyrido[2,3-b]pyrazin-7-amine |
| SMILES | NC1=CC2NC=CNC2N=C1 |
| InChI | InChI=1S/C7H10N4/c8-5-3-6-7(11-4-5)10-2-1-9-6/h1-4,6-7,9-10H,8H2 |
| InChIKey | FVIPFDFKGLFHBO-UHFFFAOYSA-N |
| XLogP | -0.73 |
| TPSA | 62.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 150.18 |
| LogP ≤ 5 | -0.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |