About 5-bromo-2-[[(1S,5S)-6-oxa-3-azabicyclo[3.2.1]octan-8-yl]oxy]benzamide
5-bromo-2-[[(1S,5S)-6-oxa-3-azabicyclo[3.2.1]octan-8-yl]oxy]benzamide (PubChem CID 118167748) has the molecular formula C13H15BrN2O3
and a molecular weight of 327.18 g/mol. Its IUPAC name is 5-bromo-2-[[(1S,5S)-6-oxa-3-azabicyclo[3.2.1]octan-8-yl]oxy]benzamide.
Molecular Properties
| Compound Name | 5-bromo-2-[[(1S,5S)-6-oxa-3-azabicyclo[3.2.1]octan-8-yl]oxy]benzamide |
| PubChem CID | 118167748 |
| Molecular Formula | C13H15BrN2O3 |
| Molecular Weight | 327.18 g/mol |
| Exact Mass | 326.03 |
| IUPAC Name | 5-bromo-2-[[(1S,5S)-6-oxa-3-azabicyclo[3.2.1]octan-8-yl]oxy]benzamide |
| SMILES | NC(=O)c1cc(Br)ccc1OC1[C@H]2CNC[C@@H]1OC2 |
| InChI | InChI=1S/C13H15BrN2O3/c14-8-1-2-10(9(3-8)13(15)17)19-12-7-4-16-5-11(12)18-6-7/h1-3,7,11-12,16H,4-6H2,(H2,15,17)/t7-,11-,12?/m0/s1 |
| InChIKey | GJCQJPDODBYBHO-KBCWANFGSA-N |
| XLogP | 0.91 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 327.18 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-bromo-2-[[(1S,5S)-6-oxa-3-azabicyclo[3.2.1]octan-8-yl]oxy]benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-bromo-2-[[(1S,5S)-6-oxa-3-azabicyclo[3.2.1]octan-8-yl]oxy]benzamide?
The IUPAC name of 5-bromo-2-[[(1S,5S)-6-oxa-3-azabicyclo[3.2.1]octan-8-yl]oxy]benzamide (CID 118167748) is 5-bromo-2-[[(1S,5S)-6-oxa-3-azabicyclo[3.2.1]octan-8-yl]oxy]benzamide.
What is the SMILES notation for 5-bromo-2-[[(1S,5S)-6-oxa-3-azabicyclo[3.2.1]octan-8-yl]oxy]benzamide?
The canonical SMILES for 5-bromo-2-[[(1S,5S)-6-oxa-3-azabicyclo[3.2.1]octan-8-yl]oxy]benzamide is NC(=O)c1cc(Br)ccc1OC1[C@H]2CNC[C@@H]1OC2.
What is the InChIKey of 5-bromo-2-[[(1S,5S)-6-oxa-3-azabicyclo[3.2.1]octan-8-yl]oxy]benzamide?
The InChIKey is GJCQJPDODBYBHO-KBCWANFGSA-N. The full InChI is InChI=1S/C13H15BrN2O3/c14-8-1-2-10(9(3-8)13(15)17)19-12-7-4-16-5-11(12)18-6-7/h1-3,7,11-12,16H,4-6H2,(H2,15,17)/t7-,11-,12?/m0/s1.
What are the key properties of 5-bromo-2-[[(1S,5S)-6-oxa-3-azabicyclo[3.2.1]octan-8-yl]oxy]benzamide?
5-bromo-2-[[(1S,5S)-6-oxa-3-azabicyclo[3.2.1]octan-8-yl]oxy]benzamide has a molecular weight of 327.18 g/mol, XLogP of 0.91, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromo-2-[[(1S,5S)-6-oxa-3-azabicyclo[3.2.1]octan-8-yl]oxy]benzamide is sourced from PubChem (CID 118167748), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).