C21H18F3N9OS — CID 118167917
3-(5-methylthiophen-2-yl)-N-[1-(1H-1,2,4-triazol-5-yl)ethyl]-8-[5-(2,2,2-trifluoroethyl)triazol-1-yl]imidazo[1,2-a]pyridine-6-carboxamide (PubChem CID 118167917) has the molecular formula C21H18F3N9OS and a molecular weight of 501.50 g/mol. Its IUPAC name is 3-(5-methylthiophen-2-yl)-N-[1-(1H-1,2,4-triazol-5-yl)ethyl]-8-[5-(2,2,2-trifluoroethyl)triazol-1-yl]imidazo[1,2-a]pyridine-6-carboxamide.
| Compound Name | 3-(5-methylthiophen-2-yl)-N-[1-(1H-1,2,4-triazol-5-yl)ethyl]-8-[5-(2,2,2-trifluoroethyl)triazol-1-yl]imidazo[1,2-a]pyridine-6-carboxamide |
|---|---|
| PubChem CID | 118167917 |
| Molecular Formula | C21H18F3N9OS |
| Molecular Weight | 501.50 g/mol |
| Exact Mass | 501.13 |
| IUPAC Name | 3-(5-methylthiophen-2-yl)-N-[1-(1H-1,2,4-triazol-5-yl)ethyl]-8-[5-(2,2,2-trifluoroethyl)triazol-1-yl]imidazo[1,2-a]pyridine-6-carboxamide |
| SMILES | Cc1ccc(-c2cnc3c(-n4nncc4CC(F)(F)F)cc(C(=O)NC(C)c4ncn[nH]4)cn23)s1 |
| InChI | InChI=1S/C21H18F3N9OS/c1-11-3-4-17(35-11)16-8-25-19-15(33-14(7-27-31-33)6-21(22,23)24)5-13(9-32(16)19)20(34)29-12(2)18-26-10-28-30-18/h3-5,7-10,12H,6H2,1-2H3,(H,29,34)(H,26,28,30) |
| InChIKey | GEHMZWBVZRTISZ-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 118.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.50 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |