C15H22O — CID 11816829
(1E,4S,7R,8Z,13R)-5,5,9-trimethyl-3-oxatricyclo[5.5.1.04,13]trideca-1(12),8-diene (PubChem CID 11816829) has the molecular formula C15H22O and a molecular weight of 218.34 g/mol. Its IUPAC name is (1E,4S,7R,8Z,13R)-5,5,9-trimethyl-3-oxatricyclo[5.5.1.04,13]trideca-1(12),8-diene.
| Compound Name | (1E,4S,7R,8Z,13R)-5,5,9-trimethyl-3-oxatricyclo[5.5.1.04,13]trideca-1(12),8-diene |
|---|---|
| PubChem CID | 11816829 |
| Molecular Formula | C15H22O |
| Molecular Weight | 218.34 g/mol |
| Exact Mass | 218.17 |
| IUPAC Name | (1E,4S,7R,8Z,13R)-5,5,9-trimethyl-3-oxatricyclo[5.5.1.04,13]trideca-1(12),8-diene |
| SMILES | C/C1=C/[C@H]2CC(C)(C)[C@H]3OC/C(=C/CC1)[C@@H]23 |
| InChI | InChI=1S/C15H22O/c1-10-5-4-6-11-9-16-14-13(11)12(7-10)8-15(14,2)3/h6-7,12-14H,4-5,8-9H2,1-3H3/b10-7-,11-6-/t12-,13-,14-/m0/s1 |
| InChIKey | GCEXPRRFWOQCGC-KNKAFWNXSA-N |
| XLogP | 3.71 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.34 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|