C29H31N5O4 — CID 118168324
4-[[4-(4-aminonaphthalen-1-yl)oxy-2-pyridinyl]amino]-2-methoxy-N-(2-morpholin-4-ylethyl)benzamide (PubChem CID 118168324) has the molecular formula C29H31N5O4 and a molecular weight of 513.60 g/mol. Its IUPAC name is 4-[[4-(4-aminonaphthalen-1-yl)oxy-2-pyridinyl]amino]-2-methoxy-N-(2-morpholin-4-ylethyl)benzamide.
| Compound Name | 4-[[4-(4-aminonaphthalen-1-yl)oxy-2-pyridinyl]amino]-2-methoxy-N-(2-morpholin-4-ylethyl)benzamide |
|---|---|
| PubChem CID | 118168324 |
| Molecular Formula | C29H31N5O4 |
| Molecular Weight | 513.60 g/mol |
| Exact Mass | 513.24 |
| IUPAC Name | 4-[[4-(4-aminonaphthalen-1-yl)oxy-2-pyridinyl]amino]-2-methoxy-N-(2-morpholin-4-ylethyl)benzamide |
| SMILES | COc1cc(Nc2cc(Oc3ccc(N)c4ccccc34)ccn2)ccc1C(=O)NCCN1CCOCC1 |
| InChI | InChI=1S/C29H31N5O4/c1-36-27-18-20(6-7-24(27)29(35)32-12-13-34-14-16-37-17-15-34)33-28-19-21(10-11-31-28)38-26-9-8-25(30)22-4-2-3-5-23(22)26/h2-11,18-19H,12-17,30H2,1H3,(H,31,33)(H,32,35) |
| InChIKey | JLWBUWLLUXSMHM-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 110.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.60 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|