C13H18O3 — CID 11816908
(3aS,5aS,7aS,7bR)-2,2,6,6-tetramethyl-3a,5a,7a,7b-tetrahydrocyclobuta[g][1,3]benzodioxol-7-one (PubChem CID 11816908) has the molecular formula C13H18O3 and a molecular weight of 222.28 g/mol. Its IUPAC name is (3aS,5aS,7aS,7bR)-2,2,6,6-tetramethyl-3a,5a,7a,7b-tetrahydrocyclobuta[g][1,3]benzodioxol-7-one.
| Compound Name | (3aS,5aS,7aS,7bR)-2,2,6,6-tetramethyl-3a,5a,7a,7b-tetrahydrocyclobuta[g][1,3]benzodioxol-7-one |
|---|---|
| PubChem CID | 11816908 |
| Molecular Formula | C13H18O3 |
| Molecular Weight | 222.28 g/mol |
| Exact Mass | 222.13 |
| IUPAC Name | (3aS,5aS,7aS,7bR)-2,2,6,6-tetramethyl-3a,5a,7a,7b-tetrahydrocyclobuta[g][1,3]benzodioxol-7-one |
| SMILES | CC1(C)O[C@@H]2[C@H]3C(=O)C(C)(C)[C@H]3C=C[C@@H]2O1 |
| InChI | InChI=1S/C13H18O3/c1-12(2)7-5-6-8-10(9(7)11(12)14)16-13(3,4)15-8/h5-10H,1-4H3/t7-,8-,9-,10-/m0/s1 |
| InChIKey | MANAPCHXGSTVJL-XKNYDFJKSA-N |
| XLogP | 1.92 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.28 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|