About 2-oxo-7-propan-2-yl-5-[1-(sulfinatoamino)cyclohexyl]spiro[1H-indole-3,1'-cyclobutane]
2-oxo-7-propan-2-yl-5-[1-(sulfinatoamino)cyclohexyl]spiro[1H-indole-3,1'-cyclobutane] (PubChem CID 118169130) has the molecular formula C20H27N2O3S-
and a molecular weight of 375.51 g/mol. Its IUPAC name is 2-oxo-7-propan-2-yl-5-[1-(sulfinatoamino)cyclohexyl]spiro[1H-indole-3,1'-cyclobutane].
Molecular Properties
| Compound Name | 2-oxo-7-propan-2-yl-5-[1-(sulfinatoamino)cyclohexyl]spiro[1H-indole-3,1'-cyclobutane] |
| PubChem CID | 118169130 |
| Molecular Formula | C20H27N2O3S- |
| Molecular Weight | 375.51 g/mol |
| Exact Mass | 375.17 |
| IUPAC Name | 2-oxo-7-propan-2-yl-5-[1-(sulfinatoamino)cyclohexyl]spiro[1H-indole-3,1'-cyclobutane] |
| SMILES | CC(C)c1cc(C2(NS(=O)[O-])CCCCC2)cc2c1NC(=O)C21CCC1 |
| InChI | InChI=1S/C20H28N2O3S/c1-13(2)15-11-14(20(22-26(24)25)9-4-3-5-10-20)12-16-17(15)21-18(23)19(16)7-6-8-19/h11-13,22H,3-10H2,1-2H3,(H,21,23)(H,24,25)/p-1 |
| InChIKey | PARPVQUSLUDLOX-UHFFFAOYSA-M |
| XLogP | 3.73 |
| TPSA | 81.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 375.51 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|
Analyze 2-oxo-7-propan-2-yl-5-[1-(sulfinatoamino)cyclohexyl]spiro[1H-indole-3,1'-cyclobutane] with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-oxo-7-propan-2-yl-5-[1-(sulfinatoamino)cyclohexyl]spiro[1H-indole-3,1'-cyclobutane]?
The IUPAC name of 2-oxo-7-propan-2-yl-5-[1-(sulfinatoamino)cyclohexyl]spiro[1H-indole-3,1'-cyclobutane] (CID 118169130) is 2-oxo-7-propan-2-yl-5-[1-(sulfinatoamino)cyclohexyl]spiro[1H-indole-3,1'-cyclobutane].
What is the SMILES notation for 2-oxo-7-propan-2-yl-5-[1-(sulfinatoamino)cyclohexyl]spiro[1H-indole-3,1'-cyclobutane]?
The canonical SMILES for 2-oxo-7-propan-2-yl-5-[1-(sulfinatoamino)cyclohexyl]spiro[1H-indole-3,1'-cyclobutane] is CC(C)c1cc(C2(NS(=O)[O-])CCCCC2)cc2c1NC(=O)C21CCC1.
What is the InChIKey of 2-oxo-7-propan-2-yl-5-[1-(sulfinatoamino)cyclohexyl]spiro[1H-indole-3,1'-cyclobutane]?
The InChIKey is PARPVQUSLUDLOX-UHFFFAOYSA-M. The full InChI is InChI=1S/C20H28N2O3S/c1-13(2)15-11-14(20(22-26(24)25)9-4-3-5-10-20)12-16-17(15)21-18(23)19(16)7-6-8-19/h11-13,22H,3-10H2,1-2H3,(H,21,23)(H,24,25)/p-1.
What are the key properties of 2-oxo-7-propan-2-yl-5-[1-(sulfinatoamino)cyclohexyl]spiro[1H-indole-3,1'-cyclobutane]?
2-oxo-7-propan-2-yl-5-[1-(sulfinatoamino)cyclohexyl]spiro[1H-indole-3,1'-cyclobutane] has a molecular weight of 375.51 g/mol, XLogP of 3.73, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-oxo-7-propan-2-yl-5-[1-(sulfinatoamino)cyclohexyl]spiro[1H-indole-3,1'-cyclobutane] is sourced from PubChem (CID 118169130), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).