About 7-[(3-bromophenyl)methyl]-8-(4-ethoxyphenyl)-6,8-dihydro-5H-tetrazolo[1,5-a]pyrazine
7-[(3-bromophenyl)methyl]-8-(4-ethoxyphenyl)-6,8-dihydro-5H-tetrazolo[1,5-a]pyrazine (PubChem CID 118169370) has the molecular formula C19H20BrN5O
and a molecular weight of 414.31 g/mol. Its IUPAC name is 7-[(3-bromophenyl)methyl]-8-(4-ethoxyphenyl)-6,8-dihydro-5H-tetrazolo[1,5-a]pyrazine.
Molecular Properties
| Compound Name | 7-[(3-bromophenyl)methyl]-8-(4-ethoxyphenyl)-6,8-dihydro-5H-tetrazolo[1,5-a]pyrazine |
| PubChem CID | 118169370 |
| Molecular Formula | C19H20BrN5O |
| Molecular Weight | 414.31 g/mol |
| Exact Mass | 413.09 |
| IUPAC Name | 7-[(3-bromophenyl)methyl]-8-(4-ethoxyphenyl)-6,8-dihydro-5H-tetrazolo[1,5-a]pyrazine |
| SMILES | CCOc1ccc(C2c3nnnn3CCN2Cc2cccc(Br)c2)cc1 |
| InChI | InChI=1S/C19H20BrN5O/c1-2-26-17-8-6-15(7-9-17)18-19-21-22-23-25(19)11-10-24(18)13-14-4-3-5-16(20)12-14/h3-9,12,18H,2,10-11,13H2,1H3 |
| InChIKey | YQZYESXYUAGTPH-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 56.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 414.31 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 7-[(3-bromophenyl)methyl]-8-(4-ethoxyphenyl)-6,8-dihydro-5H-tetrazolo[1,5-a]pyrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-[(3-bromophenyl)methyl]-8-(4-ethoxyphenyl)-6,8-dihydro-5H-tetrazolo[1,5-a]pyrazine?
The IUPAC name of 7-[(3-bromophenyl)methyl]-8-(4-ethoxyphenyl)-6,8-dihydro-5H-tetrazolo[1,5-a]pyrazine (CID 118169370) is 7-[(3-bromophenyl)methyl]-8-(4-ethoxyphenyl)-6,8-dihydro-5H-tetrazolo[1,5-a]pyrazine.
What is the SMILES notation for 7-[(3-bromophenyl)methyl]-8-(4-ethoxyphenyl)-6,8-dihydro-5H-tetrazolo[1,5-a]pyrazine?
The canonical SMILES for 7-[(3-bromophenyl)methyl]-8-(4-ethoxyphenyl)-6,8-dihydro-5H-tetrazolo[1,5-a]pyrazine is CCOc1ccc(C2c3nnnn3CCN2Cc2cccc(Br)c2)cc1.
What is the InChIKey of 7-[(3-bromophenyl)methyl]-8-(4-ethoxyphenyl)-6,8-dihydro-5H-tetrazolo[1,5-a]pyrazine?
The InChIKey is YQZYESXYUAGTPH-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H20BrN5O/c1-2-26-17-8-6-15(7-9-17)18-19-21-22-23-25(19)11-10-24(18)13-14-4-3-5-16(20)12-14/h3-9,12,18H,2,10-11,13H2,1H3.
What are the key properties of 7-[(3-bromophenyl)methyl]-8-(4-ethoxyphenyl)-6,8-dihydro-5H-tetrazolo[1,5-a]pyrazine?
7-[(3-bromophenyl)methyl]-8-(4-ethoxyphenyl)-6,8-dihydro-5H-tetrazolo[1,5-a]pyrazine has a molecular weight of 414.31 g/mol, XLogP of 3.44, 5 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 7-[(3-bromophenyl)methyl]-8-(4-ethoxyphenyl)-6,8-dihydro-5H-tetrazolo[1,5-a]pyrazine is sourced from PubChem (CID 118169370), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).