C19H21FN6 — CID 118169448
4-[7-[(3-fluorophenyl)methyl]-6,8-dihydro-5H-tetrazolo[1,5-a]pyrazin-8-yl]-N,N-dimethylaniline (PubChem CID 118169448) has the molecular formula C19H21FN6 and a molecular weight of 352.42 g/mol. Its IUPAC name is 4-[7-[(3-fluorophenyl)methyl]-6,8-dihydro-5H-tetrazolo[1,5-a]pyrazin-8-yl]-N,N-dimethylaniline.
| Compound Name | 4-[7-[(3-fluorophenyl)methyl]-6,8-dihydro-5H-tetrazolo[1,5-a]pyrazin-8-yl]-N,N-dimethylaniline |
|---|---|
| PubChem CID | 118169448 |
| Molecular Formula | C19H21FN6 |
| Molecular Weight | 352.42 g/mol |
| Exact Mass | 352.18 |
| IUPAC Name | 4-[7-[(3-fluorophenyl)methyl]-6,8-dihydro-5H-tetrazolo[1,5-a]pyrazin-8-yl]-N,N-dimethylaniline |
| SMILES | CN(C)c1ccc(C2c3nnnn3CCN2Cc2cccc(F)c2)cc1 |
| InChI | InChI=1S/C19H21FN6/c1-24(2)17-8-6-15(7-9-17)18-19-21-22-23-26(19)11-10-25(18)13-14-4-3-5-16(20)12-14/h3-9,12,18H,10-11,13H2,1-2H3 |
| InChIKey | HKDSTIICYAUQDJ-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 50.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.42 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|