C27H45N5O3 — CID 118169715
6-butyl-1-[2-[(2R,5R)-2-[[(2S,5R)-2,5-dimethylmorpholin-4-yl]methyl]-5-methylpiperazin-1-yl]acetyl]-3,3-dimethyl-2,4-dihydropyrrolo[3,2-b]pyridin-5-one (PubChem CID 118169715) has the molecular formula C27H45N5O3 and a molecular weight of 487.69 g/mol. Its IUPAC name is 6-butyl-1-[2-[(2R,5R)-2-[[(2S,5R)-2,5-dimethylmorpholin-4-yl]methyl]-5-methylpiperazin-1-yl]acetyl]-3,3-dimethyl-2,4-dihydropyrrolo[3,2-b]pyridin-5-one.
| Compound Name | 6-butyl-1-[2-[(2R,5R)-2-[[(2S,5R)-2,5-dimethylmorpholin-4-yl]methyl]-5-methylpiperazin-1-yl]acetyl]-3,3-dimethyl-2,4-dihydropyrrolo[3,2-b]pyridin-5-one |
|---|---|
| PubChem CID | 118169715 |
| Molecular Formula | C27H45N5O3 |
| Molecular Weight | 487.69 g/mol |
| Exact Mass | 487.35 |
| IUPAC Name | 6-butyl-1-[2-[(2R,5R)-2-[[(2S,5R)-2,5-dimethylmorpholin-4-yl]methyl]-5-methylpiperazin-1-yl]acetyl]-3,3-dimethyl-2,4-dihydropyrrolo[3,2-b]pyridin-5-one |
| SMILES | CCCCc1cc2c([nH]c1=O)C(C)(C)CN2C(=O)CN1C[C@@H](C)NC[C@@H]1CN1C[C@H](C)OC[C@H]1C |
| InChI | InChI=1S/C27H45N5O3/c1-7-8-9-21-10-23-25(29-26(21)34)27(5,6)17-32(23)24(33)15-31-12-18(2)28-11-22(31)14-30-13-20(4)35-16-19(30)3/h10,18-20,22,28H,7-9,11-17H2,1-6H3,(H,29,34)/t18-,19-,20+,22-/m1/s1 |
| InChIKey | OKPKWUOEPXUDRQ-XWSHUIEDSA-N |
| XLogP | 2.11 |
| TPSA | 80.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.69 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |