C13H20N2O — CID 118169726
6-butyl-3,3-dimethyl-1,2-dihydropyrrolo[2,3-c]pyridin-5-one (PubChem CID 118169726) has the molecular formula C13H20N2O and a molecular weight of 220.32 g/mol. Its IUPAC name is 6-butyl-3,3-dimethyl-1,2-dihydropyrrolo[2,3-c]pyridin-5-one.
| Compound Name | 6-butyl-3,3-dimethyl-1,2-dihydropyrrolo[2,3-c]pyridin-5-one |
|---|---|
| PubChem CID | 118169726 |
| Molecular Formula | C13H20N2O |
| Molecular Weight | 220.32 g/mol |
| Exact Mass | 220.16 |
| IUPAC Name | 6-butyl-3,3-dimethyl-1,2-dihydropyrrolo[2,3-c]pyridin-5-one |
| SMILES | CCCCn1cc2c(cc1=O)C(C)(C)CN2 |
| InChI | InChI=1S/C13H20N2O/c1-4-5-6-15-8-11-10(7-12(15)16)13(2,3)9-14-11/h7-8,14H,4-6,9H2,1-3H3 |
| InChIKey | ADPDVCGKWNEBED-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 34.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.32 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'} |
|---|