C28H36N4O5S — CID 118169840
3-[3-[[(4R)-4-ethyl-1,1-dioxo-3,4-dihydro-5,1λ6,2-benzoxathiazepin-2-yl]methyl]-4-methylphenyl]-5-(1-ethyltriazol-4-yl)hexanoic acid (PubChem CID 118169840) has the molecular formula C28H36N4O5S and a molecular weight of 540.69 g/mol. Its IUPAC name is 3-[3-[[(4R)-4-ethyl-1,1-dioxo-3,4-dihydro-5,1λ6,2-benzoxathiazepin-2-yl]methyl]-4-methylphenyl]-5-(1-ethyltriazol-4-yl)hexanoic acid.
| Compound Name | 3-[3-[[(4R)-4-ethyl-1,1-dioxo-3,4-dihydro-5,1λ6,2-benzoxathiazepin-2-yl]methyl]-4-methylphenyl]-5-(1-ethyltriazol-4-yl)hexanoic acid |
|---|---|
| PubChem CID | 118169840 |
| Molecular Formula | C28H36N4O5S |
| Molecular Weight | 540.69 g/mol |
| Exact Mass | 540.24 |
| IUPAC Name | 3-[3-[[(4R)-4-ethyl-1,1-dioxo-3,4-dihydro-5,1λ6,2-benzoxathiazepin-2-yl]methyl]-4-methylphenyl]-5-(1-ethyltriazol-4-yl)hexanoic acid |
| SMILES | CC[C@@H]1CN(Cc2cc(C(CC(=O)O)CC(C)c3cn(CC)nn3)ccc2C)S(=O)(=O)c2ccccc2O1 |
| InChI | InChI=1S/C28H36N4O5S/c1-5-24-17-32(38(35,36)27-10-8-7-9-26(27)37-24)16-23-14-21(12-11-19(23)3)22(15-28(33)34)13-20(4)25-18-31(6-2)30-29-25/h7-12,14,18,20,22,24H,5-6,13,15-17H2,1-4H3,(H,33,34)/t20?,22?,24-/m1/s1 |
| InChIKey | BKKIQOWFHQPZEE-LLAFXHEGSA-N |
| XLogP | 4.72 |
| TPSA | 114.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.69 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |