C26H27N5O6S — CID 118169887
3-[3-[(1,1-dioxo-3,4-dihydropyrido[2,3-b][1,4,5]oxathiazepin-2-yl)methyl]-4-methylphenyl]-3-(7-methoxy-1-methylbenzotriazol-5-yl)propanoic acid (PubChem CID 118169887) has the molecular formula C26H27N5O6S and a molecular weight of 537.60 g/mol. Its IUPAC name is 3-[3-[(1,1-dioxo-3,4-dihydropyrido[2,3-b][1,4,5]oxathiazepin-2-yl)methyl]-4-methylphenyl]-3-(7-methoxy-1-methylbenzotriazol-5-yl)propanoic acid.
| Compound Name | 3-[3-[(1,1-dioxo-3,4-dihydropyrido[2,3-b][1,4,5]oxathiazepin-2-yl)methyl]-4-methylphenyl]-3-(7-methoxy-1-methylbenzotriazol-5-yl)propanoic acid |
|---|---|
| PubChem CID | 118169887 |
| Molecular Formula | C26H27N5O6S |
| Molecular Weight | 537.60 g/mol |
| Exact Mass | 537.17 |
| IUPAC Name | 3-[3-[(1,1-dioxo-3,4-dihydropyrido[2,3-b][1,4,5]oxathiazepin-2-yl)methyl]-4-methylphenyl]-3-(7-methoxy-1-methylbenzotriazol-5-yl)propanoic acid |
| SMILES | COc1cc(C(CC(=O)O)c2ccc(C)c(CN3CCOc4ncccc4S3(=O)=O)c2)cc2nnn(C)c12 |
| InChI | InChI=1S/C26H27N5O6S/c1-16-6-7-17(11-19(16)15-31-9-10-37-26-23(38(31,34)35)5-4-8-27-26)20(14-24(32)33)18-12-21-25(22(13-18)36-3)30(2)29-28-21/h4-8,11-13,20H,9-10,14-15H2,1-3H3,(H,32,33) |
| InChIKey | IGSXVTNHKWFQHY-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 136.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.60 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |