C27H29N5O5S — CID 118169907
3-[3-[(4-ethyl-1,1-dioxo-3,4-dihydropyrido[2,3-b][1,4,5]oxathiazepin-2-yl)methyl]-4-methylphenyl]-3-(1-methylbenzotriazol-5-yl)propanoic acid (PubChem CID 118169907) has the molecular formula C27H29N5O5S and a molecular weight of 535.63 g/mol. Its IUPAC name is 3-[3-[(4-ethyl-1,1-dioxo-3,4-dihydropyrido[2,3-b][1,4,5]oxathiazepin-2-yl)methyl]-4-methylphenyl]-3-(1-methylbenzotriazol-5-yl)propanoic acid.
| Compound Name | 3-[3-[(4-ethyl-1,1-dioxo-3,4-dihydropyrido[2,3-b][1,4,5]oxathiazepin-2-yl)methyl]-4-methylphenyl]-3-(1-methylbenzotriazol-5-yl)propanoic acid |
|---|---|
| PubChem CID | 118169907 |
| Molecular Formula | C27H29N5O5S |
| Molecular Weight | 535.63 g/mol |
| Exact Mass | 535.19 |
| IUPAC Name | 3-[3-[(4-ethyl-1,1-dioxo-3,4-dihydropyrido[2,3-b][1,4,5]oxathiazepin-2-yl)methyl]-4-methylphenyl]-3-(1-methylbenzotriazol-5-yl)propanoic acid |
| SMILES | CCC1CN(Cc2cc(C(CC(=O)O)c3ccc4c(c3)nnn4C)ccc2C)S(=O)(=O)c2cccnc2O1 |
| InChI | InChI=1S/C27H29N5O5S/c1-4-21-16-32(38(35,36)25-6-5-11-28-27(25)37-21)15-20-12-18(8-7-17(20)2)22(14-26(33)34)19-9-10-24-23(13-19)29-30-31(24)3/h5-13,21-22H,4,14-16H2,1-3H3,(H,33,34) |
| InChIKey | VAANGWNZJXFEIA-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 127.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.63 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |