C35H46N6O4S — CID 118170195
3-pyrrolidin-1-ylpropyl 3-[3-[(1,1-dihydroxy-5-methyl-3,4-dihydro-1λ4,2,5-benzothiadiazepin-2-yl)methyl]-4-methylphenyl]-3-(1,4-dimethylbenzotriazol-5-yl)propanoate (PubChem CID 118170195) has the molecular formula C35H46N6O4S and a molecular weight of 646.86 g/mol. Its IUPAC name is 3-pyrrolidin-1-ylpropyl 3-[3-[(1,1-dihydroxy-5-methyl-3,4-dihydro-1λ4,2,5-benzothiadiazepin-2-yl)methyl]-4-methylphenyl]-3-(1,4-dimethylbenzotriazol-5-yl)propanoate.
| Compound Name | 3-pyrrolidin-1-ylpropyl 3-[3-[(1,1-dihydroxy-5-methyl-3,4-dihydro-1λ4,2,5-benzothiadiazepin-2-yl)methyl]-4-methylphenyl]-3-(1,4-dimethylbenzotriazol-5-yl)propanoate |
|---|---|
| PubChem CID | 118170195 |
| Molecular Formula | C35H46N6O4S |
| Molecular Weight | 646.86 g/mol |
| Exact Mass | 646.33 |
| IUPAC Name | 3-pyrrolidin-1-ylpropyl 3-[3-[(1,1-dihydroxy-5-methyl-3,4-dihydro-1λ4,2,5-benzothiadiazepin-2-yl)methyl]-4-methylphenyl]-3-(1,4-dimethylbenzotriazol-5-yl)propanoate |
| SMILES | Cc1ccc(C(CC(=O)OCCCN2CCCC2)c2ccc3c(nnn3C)c2C)cc1CN1CCN(C)c2ccccc2S1(O)O |
| InChI | InChI=1S/C35H46N6O4S/c1-25-12-13-27(22-28(25)24-41-20-19-38(3)31-10-5-6-11-33(31)46(41,43)44)30(23-34(42)45-21-9-18-40-16-7-8-17-40)29-14-15-32-35(26(29)2)36-37-39(32)4/h5-6,10-15,22,30,43-44H,7-9,16-21,23-24H2,1-4H3 |
| InChIKey | RZNAATITXDKZBR-UHFFFAOYSA-N |
| XLogP | 6.11 |
| TPSA | 107.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 646.86 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|