C26H27N5O5S — CID 118170326
3-(1,4-dimethylbenzotriazol-5-yl)-3-[3-[(1,1-dioxo-3,4-dihydropyrido[4,3-b][1,4,5]oxathiazepin-2-yl)methyl]-4-methylphenyl]propanoic acid (PubChem CID 118170326) has the molecular formula C26H27N5O5S and a molecular weight of 521.60 g/mol. Its IUPAC name is 3-(1,4-dimethylbenzotriazol-5-yl)-3-[3-[(1,1-dioxo-3,4-dihydropyrido[4,3-b][1,4,5]oxathiazepin-2-yl)methyl]-4-methylphenyl]propanoic acid.
| Compound Name | 3-(1,4-dimethylbenzotriazol-5-yl)-3-[3-[(1,1-dioxo-3,4-dihydropyrido[4,3-b][1,4,5]oxathiazepin-2-yl)methyl]-4-methylphenyl]propanoic acid |
|---|---|
| PubChem CID | 118170326 |
| Molecular Formula | C26H27N5O5S |
| Molecular Weight | 521.60 g/mol |
| Exact Mass | 521.17 |
| IUPAC Name | 3-(1,4-dimethylbenzotriazol-5-yl)-3-[3-[(1,1-dioxo-3,4-dihydropyrido[4,3-b][1,4,5]oxathiazepin-2-yl)methyl]-4-methylphenyl]propanoic acid |
| SMILES | Cc1ccc(C(CC(=O)O)c2ccc3c(nnn3C)c2C)cc1CN1CCOc2ccncc2S1(=O)=O |
| InChI | InChI=1S/C26H27N5O5S/c1-16-4-5-18(21(13-25(32)33)20-6-7-22-26(17(20)2)28-29-30(22)3)12-19(16)15-31-10-11-36-23-8-9-27-14-24(23)37(31,34)35/h4-9,12,14,21H,10-11,13,15H2,1-3H3,(H,32,33) |
| InChIKey | KHKRJIKQDOFQIX-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 127.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.60 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |