C10H13NOS — CID 118170358
4-ethyl-3,4-dihydro-2H-5,1,2-benzoxathiazepine (PubChem CID 118170358) has the molecular formula C10H13NOS and a molecular weight of 195.29 g/mol. Its IUPAC name is 4-ethyl-3,4-dihydro-2H-5,1,2-benzoxathiazepine.
| Compound Name | 4-ethyl-3,4-dihydro-2H-5,1,2-benzoxathiazepine |
|---|---|
| PubChem CID | 118170358 |
| Molecular Formula | C10H13NOS |
| Molecular Weight | 195.29 g/mol |
| Exact Mass | 195.07 |
| IUPAC Name | 4-ethyl-3,4-dihydro-2H-5,1,2-benzoxathiazepine |
| SMILES | CCC1CNSc2ccccc2O1 |
| InChI | InChI=1S/C10H13NOS/c1-2-8-7-11-13-10-6-4-3-5-9(10)12-8/h3-6,8,11H,2,7H2,1H3 |
| InChIKey | BZFRXFRLBLAWBZ-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.29 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|