C21H24BrN3O3 — CID 118170818
ethyl 3-[3-(bromomethyl)-4-methylphenyl]-3-(7-methoxy-1-methylbenzotriazol-5-yl)propanoate (PubChem CID 118170818) has the molecular formula C21H24BrN3O3 and a molecular weight of 446.35 g/mol. Its IUPAC name is ethyl 3-[3-(bromomethyl)-4-methylphenyl]-3-(7-methoxy-1-methylbenzotriazol-5-yl)propanoate.
| Compound Name | ethyl 3-[3-(bromomethyl)-4-methylphenyl]-3-(7-methoxy-1-methylbenzotriazol-5-yl)propanoate |
|---|---|
| PubChem CID | 118170818 |
| Molecular Formula | C21H24BrN3O3 |
| Molecular Weight | 446.35 g/mol |
| Exact Mass | 445.10 |
| IUPAC Name | ethyl 3-[3-(bromomethyl)-4-methylphenyl]-3-(7-methoxy-1-methylbenzotriazol-5-yl)propanoate |
| SMILES | CCOC(=O)CC(c1ccc(C)c(CBr)c1)c1cc(OC)c2c(c1)nnn2C |
| InChI | InChI=1S/C21H24BrN3O3/c1-5-28-20(26)11-17(14-7-6-13(2)16(8-14)12-22)15-9-18-21(19(10-15)27-4)25(3)24-23-18/h6-10,17H,5,11-12H2,1-4H3 |
| InChIKey | QUFDWEIOFBFVBL-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 66.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.35 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|