C26H24N6O2 — CID 118170957
3-[1-[(4-cyanophenyl)methyl]-3,5-diethylpyrazol-4-yl]quinoline-2,4-dicarboxamide (PubChem CID 118170957) has the molecular formula C26H24N6O2 and a molecular weight of 452.52 g/mol. Its IUPAC name is 3-[1-[(4-cyanophenyl)methyl]-3,5-diethylpyrazol-4-yl]quinoline-2,4-dicarboxamide.
| Compound Name | 3-[1-[(4-cyanophenyl)methyl]-3,5-diethylpyrazol-4-yl]quinoline-2,4-dicarboxamide |
|---|---|
| PubChem CID | 118170957 |
| Molecular Formula | C26H24N6O2 |
| Molecular Weight | 452.52 g/mol |
| Exact Mass | 452.20 |
| IUPAC Name | 3-[1-[(4-cyanophenyl)methyl]-3,5-diethylpyrazol-4-yl]quinoline-2,4-dicarboxamide |
| SMILES | CCc1nn(Cc2ccc(C#N)cc2)c(CC)c1-c1c(C(N)=O)nc2ccccc2c1C(N)=O |
| InChI | InChI=1S/C26H24N6O2/c1-3-18-22(20(4-2)32(31-18)14-16-11-9-15(13-27)10-12-16)23-21(25(28)33)17-7-5-6-8-19(17)30-24(23)26(29)34/h5-12H,3-4,14H2,1-2H3,(H2,28,33)(H2,29,34) |
| InChIKey | VIWKSUBOTDXTGC-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 140.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.52 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |